Difference between revisions of "2.1.1.72-RXN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-5662 == * common-name: ** 9-mercaptodethiobiotin * inchi-key: ** zarfdbykhcotrh-uhfffaoysa-m * molecular-weight: ** 245.316 * smiles:...")
(Created page with "Category:reaction == Reaction 2.1.1.72-RXN == * ec-number: ** [http://enzyme.expasy.org/EC/2.1.1.72 ec-2.1.1.72] * direction: ** left-to-right == Reaction formula == * 1 [...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:reaction]]
== Metabolite CPD-5662 ==
+
== Reaction 2.1.1.72-RXN ==
* common-name:
+
* ec-number:
** 9-mercaptodethiobiotin
+
** [http://enzyme.expasy.org/EC/2.1.1.72 ec-2.1.1.72]
* inchi-key:
+
* direction:
** zarfdbykhcotrh-uhfffaoysa-m
+
** left-to-right
* molecular-weight:
+
== Reaction formula ==
** 245.316
+
* 1 [[DNA-Adenines]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[DNA-Containing-N6-Methyladenine]][c] '''+''' 1 [[PROTON]][c]
* smiles:
+
== Gene(s) associated with this reaction  ==
** c(s)c1(c(nc(n1)=o)cccccc(=o)[o-])
+
* Gene: [[FSU_RS08600]]
== Reaction(s) known to consume the compound ==
+
** Category: [[manual]]
* [[RXN-17473]]
+
*** Source: [[add_expert_reactions]], Tool: [[unknown-tool]], Assignment: n.a, Comment: added to improve flux in sugars
== Reaction(s) known to produce the compound ==
+
* Gene: [[FSU_RS03210]]
* [[RXN-17472]]
+
** Category: [[manual]]
== Reaction(s) of unknown directionality ==
+
*** Source: [[add_expert_reactions]], Tool: [[unknown-tool]], Assignment: n.a, Comment: added to improve flux in sugars
{{#set: common-name=9-mercaptodethiobiotin}}
+
== Pathway(s) ==
{{#set: inchi-key=inchikey=zarfdbykhcotrh-uhfffaoysa-m}}
+
== Reconstruction information  ==
{{#set: molecular-weight=245.316}}
+
* category: [[manual]]; source: [[add_expert_reactions]]; tool: [[curation]]; comment: present in the annotation part in the first version of the fibrobacter gem
 +
== External links  ==
 +
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* RHEA:
 +
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15198 15198]
 +
* LIGAND-RXN:
 +
** [http://www.genome.jp/dbget-bin/www_bget?R02961 R02961]
 +
* UNIPROT:
 +
** [http://www.uniprot.org/uniprot/Q7B7V5 Q7B7V5]
 +
** [http://www.uniprot.org/uniprot/P44414 P44414]
 +
** [http://www.uniprot.org/uniprot/Q57168 Q57168]
 +
** [http://www.uniprot.org/uniprot/Q9PIS1 Q9PIS1]
 +
** [http://www.uniprot.org/uniprot/P44431 P44431]
 +
** [http://www.uniprot.org/uniprot/P95510 P95510]
 +
** [http://www.uniprot.org/uniprot/P29749 P29749]
 +
** [http://www.uniprot.org/uniprot/P14385 P14385]
 +
** [http://www.uniprot.org/uniprot/P43422 P43422]
 +
** [http://www.uniprot.org/uniprot/Q47911 Q47911]
 +
** [http://www.uniprot.org/uniprot/P21311 P21311]
 +
** [http://www.uniprot.org/uniprot/P14751 P14751]
 +
** [http://www.uniprot.org/uniprot/P14827 P14827]
 +
** [http://www.uniprot.org/uniprot/P25240 P25240]
 +
** [http://www.uniprot.org/uniprot/P25239 P25239]
 +
** [http://www.uniprot.org/uniprot/P29538 P29538]
 +
** [http://www.uniprot.org/uniprot/Q03055 Q03055]
 +
** [http://www.uniprot.org/uniprot/Q51829 Q51829]
 +
** [http://www.uniprot.org/uniprot/P25238 P25238]
 +
** [http://www.uniprot.org/uniprot/P35516 P35516]
 +
** [http://www.uniprot.org/uniprot/P33563 P33563]
 +
** [http://www.uniprot.org/uniprot/P43641 P43641]
 +
** [http://www.uniprot.org/uniprot/P45454 P45454]
 +
** [http://www.uniprot.org/uniprot/P50193 P50193]
 +
** [http://www.uniprot.org/uniprot/Q56004 Q56004]
 +
** [http://www.uniprot.org/uniprot/P73682 P73682]
 +
** [http://www.uniprot.org/uniprot/P31118 P31118]
 +
** [http://www.uniprot.org/uniprot/O41063 O41063]
 +
** [http://www.uniprot.org/uniprot/P12427 P12427]
 +
** [http://www.uniprot.org/uniprot/P04392 P04392]
 +
** [http://www.uniprot.org/uniprot/P0AEE8 P0AEE8]
 +
** [http://www.uniprot.org/uniprot/P08957 P08957]
 +
** [http://www.uniprot.org/uniprot/P00472 P00472]
 +
** [http://www.uniprot.org/uniprot/P04393 P04393]
 +
** [http://www.uniprot.org/uniprot/P00473 P00473]
 +
** [http://www.uniprot.org/uniprot/P24582 P24582]
 +
** [http://www.uniprot.org/uniprot/P00474 P00474]
 +
** [http://www.uniprot.org/uniprot/P04043 P04043]
 +
</div>
 +
{{#set: ec-number=ec-2.1.1.72}}
 +
{{#set: direction=left-to-right}}
 +
{{#set: nb gene associated=2}}
 +
{{#set: nb pathway associated=0}}
 +
{{#set: reconstruction category=manual}}
 +
{{#set: reconstruction tool=curation}}
 +
{{#set: reconstruction comment=present in the annotation part in the first version of the fibrobacter gem}}
 +
{{#set: reconstruction source=add_expert_reactions}}

Latest revision as of 11:15, 17 October 2022

Reaction 2.1.1.72-RXN

Reaction formula

Gene(s) associated with this reaction

Pathway(s)

Reconstruction information

External links