Difference between revisions of "RXN-10917"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ALL-TRANS-PENTAPRENYL-DIPHOSPHATE == * common-name: ** geranylfarnesyl diphosphate * inchi-key: ** jmvsbfjbmxqnjw-gixzanjisa-k * molecula...")
(Created page with "Category:reaction == Reaction RXN-10917 == * ec-number: ** [http://enzyme.expasy.org/EC/1.2.1.3 ec-1.2.1.3] * direction: ** left-to-right == Reaction formula == * 1 CPD-...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:reaction]]
== Metabolite ALL-TRANS-PENTAPRENYL-DIPHOSPHATE ==
+
== Reaction RXN-10917 ==
* common-name:
+
* ec-number:
** geranylfarnesyl diphosphate
+
** [http://enzyme.expasy.org/EC/1.2.1.3 ec-1.2.1.3]
* inchi-key:
+
* direction:
** jmvsbfjbmxqnjw-gixzanjisa-k
+
** left-to-right
* molecular-weight:
+
== Reaction formula ==
** 515.542
+
* 1 [[CPD-11876]][c] '''+''' 1 [[NAD]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[NADH]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[VANILLYL_MANDELATE]][c]
* smiles:
+
== Gene(s) associated with this reaction  ==
** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cop(=o)([o-])op(=o)([o-])[o-]
+
* Gene: [[FSU_RS01755]]
== Reaction(s) known to consume the compound ==
+
** Category: [[manual]]
== Reaction(s) known to produce the compound ==
+
*** Source: [[add_expert_reactions]], Tool: [[unknown-tool]], Assignment: n.a, Comment: added to improve flux in sugars
* [[RXN-8813]]
+
== Pathway(s) ==
== Reaction(s) of unknown directionality ==
+
* [[PWY-6342]], noradrenaline and adrenaline degradation:
{{#set: common-name=geranylfarnesyl diphosphate}}
+
** '''4''' reactions found over '''13''' reactions in the full pathway
{{#set: inchi-key=inchikey=jmvsbfjbmxqnjw-gixzanjisa-k}}
+
== Reconstruction information  ==
{{#set: molecular-weight=515.542}}
+
* category: [[manual]]; source: [[add_expert_reactions]]; tool: [[curation]]; comment: present in the annotation part in the first version of the fibrobacter gem
 +
== External links  ==
 +
* LIGAND-RXN:
 +
** [http://www.genome.jp/dbget-bin/www_bget?R04891 R04891]
 +
{{#set: ec-number=ec-1.2.1.3}}
 +
{{#set: direction=left-to-right}}
 +
{{#set: nb gene associated=1}}
 +
{{#set: nb pathway associated=1}}
 +
{{#set: reconstruction category=manual}}
 +
{{#set: reconstruction tool=curation}}
 +
{{#set: reconstruction comment=present in the annotation part in the first version of the fibrobacter gem}}
 +
{{#set: reconstruction source=add_expert_reactions}}

Latest revision as of 11:15, 17 October 2022

Reaction RXN-10917

Reaction formula

Gene(s) associated with this reaction

Pathway(s)

  • PWY-6342, noradrenaline and adrenaline degradation:
    • 4 reactions found over 13 reactions in the full pathway

Reconstruction information

External links