Difference between revisions of "ORNITHINE-CYCLODEAMINASE-RXN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-OCTAPRENYLPHENOL == * common-name: ** 2-octaprenylphenol * inchi-key: ** vunqjppptjiren-cmaxttdksa-n * molecular-weight: ** 639.058 * s...")
(Created page with "Category:reaction == Reaction ORNITHINE-CYCLODEAMINASE-RXN == * ec-number: ** [http://enzyme.expasy.org/EC/4.3.1.12 ec-4.3.1.12] * direction: ** left-to-right == Reaction...")
 
(11 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:reaction]]
== Metabolite 2-OCTAPRENYLPHENOL ==
+
== Reaction ORNITHINE-CYCLODEAMINASE-RXN ==
* common-name:
+
* ec-number:
** 2-octaprenylphenol
+
** [http://enzyme.expasy.org/EC/4.3.1.12 ec-4.3.1.12]
* inchi-key:
+
* direction:
** vunqjppptjiren-cmaxttdksa-n
+
** left-to-right
* molecular-weight:
+
== Reaction formula ==
** 639.058
+
* 1 [[L-ORNITHINE]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[PRO]][c]
* smiles:
+
== Gene(s) associated with this reaction  ==
** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(/c(\o)=c/c=cc=1)
+
== Pathway(s) ==
== Reaction(s) known to consume the compound ==
+
* [[ORN-AMINOPENTANOATE-CAT-PWY]], L-ornithine degradation I (L-proline biosynthesis):
* [[2-OCTAPRENYLPHENOL-HYDROX-RXN]]
+
** '''1''' reactions found over '''1''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[ARG-GLU-PWY]], L-arginine degradation VII (arginase 3 pathway):
* [[3-OCTAPRENYL-4-OHBENZOATE-DECARBOX-RXN]]
+
** '''2''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
== Reconstruction information  ==
{{#set: common-name=2-octaprenylphenol}}
+
* category: [[gap-filling]]; source: [[gapfilling_solution_with_meneco_draft_spontaneous]]; tool: [[meneco]]; comment: added for gapfilling
{{#set: inchi-key=inchikey=vunqjppptjiren-cmaxttdksa-n}}
+
== External links  ==
{{#set: molecular-weight=639.058}}
+
* RHEA:
 +
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24369 24369]
 +
* LIGAND-RXN:
 +
** [http://www.genome.jp/dbget-bin/www_bget?R00671 R00671]
 +
* UNIPROT:
 +
** [http://www.uniprot.org/uniprot/Q59701 Q59701]
 +
** [http://www.uniprot.org/uniprot/P09773 P09773]
 +
** [http://www.uniprot.org/uniprot/P33728 P33728]
 +
** [http://www.uniprot.org/uniprot/O68052 O68052]
 +
** [http://www.uniprot.org/uniprot/Q9WWA2 Q9WWA2]
 +
{{#set: ec-number=ec-4.3.1.12}}
 +
{{#set: direction=left-to-right}}
 +
{{#set: nb gene associated=0}}
 +
{{#set: nb pathway associated=2}}
 +
{{#set: reconstruction category=gap-filling}}
 +
{{#set: reconstruction tool=meneco}}
 +
{{#set: reconstruction comment=added for gapfilling}}
 +
{{#set: reconstruction source=gapfilling_solution_with_meneco_draft_spontaneous}}

Latest revision as of 11:16, 17 October 2022

Reaction ORNITHINE-CYCLODEAMINASE-RXN

Reaction formula

Gene(s) associated with this reaction

Pathway(s)

  • ORN-AMINOPENTANOATE-CAT-PWY, L-ornithine degradation I (L-proline biosynthesis):
    • 1 reactions found over 1 reactions in the full pathway
  • ARG-GLU-PWY, L-arginine degradation VII (arginase 3 pathway):
    • 2 reactions found over 2 reactions in the full pathway

Reconstruction information

External links