Difference between revisions of "RXN-17729"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9612 == * common-name: ** caldariellaquinone * inchi-key: ** ghrwxpxobgrshg-uhfffaoysa-n * molecular-weight: ** 631.069 * smiles: **...")
(Created page with "Category:reaction == Reaction RXN-17729 == * ec-number: ** [http://enzyme.expasy.org/EC/2.3.1.51 ec-2.3.1.51] * direction: ** left-to-right * common-name: ** 1-acyl-sn-gly...")
 
(13 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:reaction]]
−
== Metabolite CPD-9612 ==
+
== Reaction RXN-17729 ==
 +
* ec-number:
 +
** [http://enzyme.expasy.org/EC/2.3.1.51 ec-2.3.1.51]
 +
* direction:
 +
** left-to-right
 
* common-name:
 
* common-name:
−
** caldariellaquinone
+
** 1-acyl-sn-glycerol-3-phosphate acyltransferase
−
* inchi-key:
+
== Reaction formula ==
−
** ghrwxpxobgrshg-uhfffaoysa-n
+
* 1 [[1-Alkyl-sn-glycerol-3-phosphates]][c] '''+''' 1 [[ACYL-COA]][c] '''=>''' 1 [[1-Alkyl-2-acyl-glycerol-3-phosphate]][c] '''+''' 1 [[CO-A]][c]
−
* molecular-weight:
+
== Gene(s) associated with this reaction  ==
−
** 631.069
+
* Gene: [[FISUC_RS05530]]
−
* smiles:
+
** Category: [[annotation]]
−
** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc1(\c(=o)c2(\sc=cc(\c(=o)c(\sc)=1)=2))
+
*** Source: [[fibrobacter_succinogenes2]], Tool: [[pathwaytools]], Assignment: automated-name-match, Comment: n.a
−
== Reaction(s) known to consume the compound ==
+
* Gene: [[FISUC_RS15140]]
−
* [[RXN-15378]]
+
** Category: [[annotation]]
−
== Reaction(s) known to produce the compound ==
+
*** Source: [[fibrobacter_succinogenes2]], Tool: [[pathwaytools]], Assignment: automated-name-match, Comment: n.a
−
== Reaction(s) of unknown directionality ==
+
* Gene: [[FSU_RS01330]]
−
{{#set: common-name=caldariellaquinone}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=ghrwxpxobgrshg-uhfffaoysa-n}}
+
*** Source: [[fibrobacter_succinogenes1]], Tool: [[pathwaytools]], Assignment: automated-name-match, Comment: n.a
−
{{#set: molecular-weight=631.069}}
+
* Gene: [[FSU_RS00315]]
 +
** Category: [[annotation]]
 +
*** Source: [[fibrobacter_succinogenes1]], Tool: [[pathwaytools]], Assignment: automated-name-match, Comment: n.a
 +
* Gene: [[FSU_RS07430]]
 +
** Category: [[annotation]]
 +
*** Source: [[fibrobacter_succinogenes1]], Tool: [[pathwaytools]], Assignment: automated-name-match, Comment: n.a
 +
* Gene: [[FISUC_RS14120]]
 +
** Category: [[annotation]]
 +
*** Source: [[fibrobacter_succinogenes2]], Tool: [[pathwaytools]], Assignment: automated-name-match, Comment: n.a
 +
== Pathway(s) ==
 +
* [[PWY-7782]], plasmalogen biosynthesis:
 +
** '''2''' reactions found over '''16''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* category: [[annotation]]; source: [[fibrobacter_succinogenes1]]; tool: [[pathwaytools]]; comment: n.a
 +
* category: [[annotation]]; source: [[fibrobacter_succinogenes2]]; tool: [[pathwaytools]]; comment: n.a
 +
== External links  ==
 +
{{#set: ec-number=ec-2.3.1.51}}
 +
{{#set: direction=left-to-right}}
 +
{{#set: common-name=1-acyl-sn-glycerol-3-phosphate acyltransferase}}
 +
{{#set: nb gene associated=6}}
 +
{{#set: nb pathway associated=1}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}
 +
{{#set: reconstruction comment=n.a}}
 +
{{#set: reconstruction source=fibrobacter_succinogenes2|fibrobacter_succinogenes1}}

Latest revision as of 11:17, 17 October 2022

Reaction RXN-17729

  • ec-number:
  • direction:
    • left-to-right
  • common-name:
    • 1-acyl-sn-glycerol-3-phosphate acyltransferase

Reaction formula

Gene(s) associated with this reaction

Pathway(s)

  • PWY-7782, plasmalogen biosynthesis:
    • 2 reactions found over 16 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.genouest.org//fsucgem/index.php?title=RXN-17729&oldid=92834"