Difference between revisions of "GARTRANSFORMYL2-RXN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UBIQUINOL-30 == * common-name: ** ubiquinol-6 * inchi-key: ** dyoscpiqeyrqeo-lphqiwjtsa-n * molecular-weight: ** 592.901 * smiles: ** cc(...")
(Created page with "Category:reaction == Reaction GARTRANSFORMYL2-RXN == * ec-number: ** [http://enzyme.expasy.org/EC/2.1.2 ec-2.1.2] * direction: ** left-to-right == Reaction formula == * 1...")
 
(8 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:reaction]]
== Metabolite UBIQUINOL-30 ==
+
== Reaction GARTRANSFORMYL2-RXN ==
* common-name:
+
* ec-number:
** ubiquinol-6
+
** [http://enzyme.expasy.org/EC/2.1.2 ec-2.1.2]
* inchi-key:
+
* direction:
** dyoscpiqeyrqeo-lphqiwjtsa-n
+
** left-to-right
* molecular-weight:
+
== Reaction formula ==
** 592.901
+
* 1 [[5-PHOSPHO-RIBOSYL-GLYCINEAMIDE]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[FORMATE]][c] '''=>''' 1 [[5-P-RIBOSYL-N-FORMYLGLYCINEAMIDE]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Pi]][c]
* smiles:
+
== Gene(s) associated with this reaction  ==
** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(/c(/o)=c(c(/oc)=c(c(\c)=1)/o)/oc)
+
* Gene: [[FSU_RS04650]]
== Reaction(s) known to consume the compound ==
+
** Category: [[orthology]]
== Reaction(s) known to produce the compound ==
+
*** Source: [[ecoli]], Tool: [[orthofinder]], Assignment: n.a, Comment: n.a
* [[SUCCINATE-DEHYDROGENASE-UBIQUINONE6-RXN]]
+
*** Source: [[bifidobacterium]], Tool: [[orthofinder]], Assignment: n.a, Comment: n.a
== Reaction(s) of unknown directionality ==
+
*** Source: [[bthetaiotaomicron]], Tool: [[orthofinder]], Assignment: n.a, Comment: n.a
{{#set: common-name=ubiquinol-6}}
+
== Pathway(s) ==
{{#set: inchi-key=inchikey=dyoscpiqeyrqeo-lphqiwjtsa-n}}
+
* [[PWY-6277]], superpathway of 5-aminoimidazole ribonucleotide biosynthesis:
{{#set: molecular-weight=592.901}}
+
** '''7''' reactions found over '''5''' reactions in the full pathway
 +
* [[PWY-6122]], 5-aminoimidazole ribonucleotide biosynthesis II:
 +
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* category: [[orthology]]; source: [[bthetaiotaomicron]]; tool: [[orthofinder]]; comment: n.a
 +
* category: [[orthology]]; source: [[ecoli]]; tool: [[orthofinder]]; comment: n.a
 +
* category: [[orthology]]; source: [[bifidobacterium]]; tool: [[orthofinder]]; comment: n.a
 +
== External links  ==
 +
* RHEA:
 +
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24830 24830]
 +
* LIGAND-RXN:
 +
** [http://www.genome.jp/dbget-bin/www_bget?R06974 R06974]
 +
{{#set: ec-number=ec-2.1.2}}
 +
{{#set: direction=left-to-right}}
 +
{{#set: nb gene associated=1}}
 +
{{#set: nb pathway associated=2}}
 +
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction tool=orthofinder}}
 +
{{#set: reconstruction comment=n.a}}
 +
{{#set: reconstruction source=bifidobacterium|ecoli|bthetaiotaomicron}}

Latest revision as of 11:17, 17 October 2022

Reaction GARTRANSFORMYL2-RXN

  • ec-number:
  • direction:
    • left-to-right

Reaction formula

Gene(s) associated with this reaction

Pathway(s)

  • PWY-6277, superpathway of 5-aminoimidazole ribonucleotide biosynthesis:
    • 7 reactions found over 5 reactions in the full pathway
  • PWY-6122, 5-aminoimidazole ribonucleotide biosynthesis II:
    • 5 reactions found over 5 reactions in the full pathway

Reconstruction information

External links