Difference between revisions of "RXN-16788"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ANTHRANILATE == * common-name: ** anthranilate * inchi-key: ** rwzyaggxghygmb-uhfffaoysa-m * molecular-weight: ** 136.13 * smiles: ** c(c...")
(Created page with "Category:reaction == Reaction RXN-16788 == * ec-number: ** [http://enzyme.expasy.org/EC/3.1.3.73 ec-3.1.3.73] * direction: ** left-to-right == Reaction formula == * 1 AL...")
 
(11 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:reaction]]
== Metabolite ANTHRANILATE ==
+
== Reaction RXN-16788 ==
* common-name:
+
* ec-number:
** anthranilate
+
** [http://enzyme.expasy.org/EC/3.1.3.73 ec-3.1.3.73]
* inchi-key:
+
* direction:
** rwzyaggxghygmb-uhfffaoysa-m
+
** left-to-right
* molecular-weight:
+
== Reaction formula ==
** 136.13
+
* 1 [[ALPHA-RIBAZOLE-5-P]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[ALPHA-RIBAZOLE]][c] '''+''' 1 [[Pi]][c]
* smiles:
+
== Gene(s) associated with this reaction  ==
** c(c1(/c(\n)=c/c=cc=1))(=o)[o-]
+
== Pathway(s) ==
== Reaction(s) known to consume the compound ==
+
== Reconstruction information  ==
* [[ANTHRANSYN-RXN]]
+
* category: [[manual]]; source: [[add_reactions_to_reach_targets]]; tool: [[curation]]; comment: added to reach alpha-ribazole
* [[PRTRANS-RXN]]
+
== External links  ==
== Reaction(s) known to produce the compound ==
+
* LIGAND-RXN:
* [[ANTHRANSYN-RXN]]
+
** [http://www.genome.jp/dbget-bin/www_bget?R04594 R04594]
* [[PRTRANS-RXN]]
+
* RHEA:
== Reaction(s) of unknown directionality ==
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24457 24457]
{{#set: common-name=anthranilate}}
+
{{#set: ec-number=ec-3.1.3.73}}
{{#set: inchi-key=inchikey=rwzyaggxghygmb-uhfffaoysa-m}}
+
{{#set: direction=left-to-right}}
{{#set: molecular-weight=136.13}}
+
{{#set: nb gene associated=0}}
 +
{{#set: nb pathway associated=0}}
 +
{{#set: reconstruction category=manual}}
 +
{{#set: reconstruction tool=curation}}
 +
{{#set: reconstruction comment=added to reach alpha-ribazole}}
 +
{{#set: reconstruction source=add_reactions_to_reach_targets}}

Latest revision as of 11:17, 17 October 2022

Reaction RXN-16788

Reaction formula

Gene(s) associated with this reaction

Pathway(s)

Reconstruction information

External links