Difference between revisions of "ExchangeSeed-NADH"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-METHYL-METHOXY-BENZQ == * common-name: ** 6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol * inchi-key: ** hdsgdgslnm...")
(Created page with "Category:reaction == Reaction ExchangeSeed-NADH == * direction: ** reversible == Reaction formula == * 1.0 NADH[C-BOUNDARY] '''<=>''' 1.0 NADH[e] == Gene(s) associ...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:reaction]]
== Metabolite OCTAPRENYL-METHYL-METHOXY-BENZQ ==
+
== Reaction ExchangeSeed-NADH ==
* common-name:
+
* direction:
** 6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol
+
** reversible
* inchi-key:
+
== Reaction formula ==
** hdsgdgslnmimku-kfsstaeesa-n
+
* 1.0 [[NADH]][C-BOUNDARY] '''<=>''' 1.0 [[NADH]][e]
* molecular-weight:
+
== Gene(s) associated with this reaction  ==
** 699.111
+
== Pathway(s) ==
* smiles:
+
== Reconstruction information  ==
** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(\c(/c)=c(c=c(c(\o)=1)oc)/o)
+
* category: [[manual]]; source: [[import_from_medium]]; tool: [[curation]]; comment: added to manage seeds from boundary to extracellular compartment
== Reaction(s) known to consume the compound ==
+
== External links  ==
* [[OCTAPRENYL-METHYL-METHOXY-BENZOQ-OH-RXN]]
+
{{#set: direction=reversible}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb gene associated=0}}
* [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]]
+
{{#set: nb pathway associated=0}}
== Reaction(s) of unknown directionality ==
+
{{#set: reconstruction category=manual}}
{{#set: common-name=6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol}}
+
{{#set: reconstruction tool=curation}}
{{#set: inchi-key=inchikey=hdsgdgslnmimku-kfsstaeesa-n}}
+
{{#set: reconstruction comment=added to manage seeds from boundary to extracellular compartment}}
{{#set: molecular-weight=699.111}}
+
{{#set: reconstruction source=import_from_medium}}

Latest revision as of 11:17, 17 October 2022

Reaction ExchangeSeed-NADH

  • direction:
    • reversible

Reaction formula

Gene(s) associated with this reaction

Pathway(s)

Reconstruction information

External links