Difference between revisions of "1.2.1.13-RXN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12117 == * common-name: ** demethylmenaquinol-7 * inchi-key: ** ufzdimbxtvrbds-ssqlmynasa-n * molecular-weight: ** 636.999 * smiles:...")
(Created page with "Category:reaction == Reaction 1.2.1.13-RXN == * ec-number: ** [http://enzyme.expasy.org/EC/1.2.1.13 ec-1.2.1.13] * direction: ** left-to-right == Reaction formula == * 1 [...")
 
(14 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:reaction]]
−
== Metabolite CPD-12117 ==
+
== Reaction 1.2.1.13-RXN ==
−
* common-name:
+
* ec-number:
−
** demethylmenaquinol-7
+
** [http://enzyme.expasy.org/EC/1.2.1.13 ec-1.2.1.13]
−
* inchi-key:
+
* direction:
−
** ufzdimbxtvrbds-ssqlmynasa-n
+
** left-to-right
−
* molecular-weight:
+
== Reaction formula ==
−
** 636.999
+
* 1 [[DPG]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[GAP]][c] '''+''' 1 [[NADP]][c] '''+''' 1 [[Pi]][c]
−
* smiles:
+
== Gene(s) associated with this reaction  ==
−
** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(\c=c(o)c2(\c=cc=cc(/c(\o)=1)=2))
+
== Pathway(s) ==
−
== Reaction(s) known to consume the compound ==
+
* [[CALVIN-PWY]], Calvin-Benson-Bassham cycle:
−
* [[RXN-9191]]
+
** '''11''' reactions found over '''13''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
== Reconstruction information  ==
−
* [[RXN-9190]]
+
* category: [[manual]]; source: [[add_expert_reactions]]; tool: [[curation]]; comment: added to improve flux in sugars
−
== Reaction(s) of unknown directionality ==
+
== External links  ==
−
{{#set: common-name=demethylmenaquinol-7}}
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
{{#set: inchi-key=inchikey=ufzdimbxtvrbds-ssqlmynasa-n}}
+
* RHEA:
−
{{#set: molecular-weight=636.999}}
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10298 10298]
 +
* LIGAND-RXN:
 +
** [http://www.genome.jp/dbget-bin/www_bget?R01063 R01063]
 +
* UNIPROT:
 +
** [http://www.uniprot.org/uniprot/P09672 P09672]
 +
** [http://www.uniprot.org/uniprot/P09094 P09094]
 +
** [http://www.uniprot.org/uniprot/P12858 P12858]
 +
** [http://www.uniprot.org/uniprot/P12859 P12859]
 +
** [http://www.uniprot.org/uniprot/P12860 P12860]
 +
** [http://www.uniprot.org/uniprot/P09315 P09315]
 +
** [http://www.uniprot.org/uniprot/P25856 P25856]
 +
** [http://www.uniprot.org/uniprot/Q7M1R8 Q7M1R8]
 +
** [http://www.uniprot.org/uniprot/Q7M1R7 Q7M1R7]
 +
** [http://www.uniprot.org/uniprot/Q37174 Q37174]
 +
** [http://www.uniprot.org/uniprot/P30724 P30724]
 +
** [http://www.uniprot.org/uniprot/P80505 P80505]
 +
** [http://www.uniprot.org/uniprot/Q55245 Q55245]
 +
** [http://www.uniprot.org/uniprot/O22534 O22534]
 +
** [http://www.uniprot.org/uniprot/P50362 P50362]
 +
** [http://www.uniprot.org/uniprot/P19866 P19866]
 +
** [http://www.uniprot.org/uniprot/Q41019 Q41019]
 +
</div>
 +
{{#set: ec-number=ec-1.2.1.13}}
 +
{{#set: direction=left-to-right}}
 +
{{#set: nb gene associated=0}}
 +
{{#set: nb pathway associated=1}}
 +
{{#set: reconstruction category=manual}}
 +
{{#set: reconstruction tool=curation}}
 +
{{#set: reconstruction comment=added to improve flux in sugars}}
 +
{{#set: reconstruction source=add_expert_reactions}}

Latest revision as of 11:17, 17 October 2022

Reaction 1.2.1.13-RXN

Reaction formula

Gene(s) associated with this reaction

Pathway(s)

  • CALVIN-PWY, Calvin-Benson-Bassham cycle:
    • 11 reactions found over 13 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.genouest.org//fsucgem/index.php?title=1.2.1.13-RXN&oldid=93041"