Difference between revisions of "Repressor-LexA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-OCTAPRENYL-6-METHOXYPHENOL == * common-name: ** 2-methoxy-6-(all-trans-octaprenyl)phenol * inchi-key: ** margkpimnmaskj-cmaxttdksa-n *...")
(Created page with "Category:metabolite == Metabolite repressor-LexA == * common-name: ** repressor lexa == Reaction(s) known to consume the compound == * 3.4.21.88-RXN == Reaction(s) kno...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-OCTAPRENYL-6-METHOXYPHENOL ==
+
== Metabolite repressor-LexA ==
 
* common-name:
 
* common-name:
** 2-methoxy-6-(all-trans-octaprenyl)phenol
+
** repressor lexa
* inchi-key:
 
** margkpimnmaskj-cmaxttdksa-n
 
* molecular-weight:
 
** 669.085
 
* smiles:
 
** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(/c(/o)=c(c=cc=1)/oc)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.4.21.88-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2-OCTAPRENYL-6-OHPHENOL-METHY-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methoxy-6-(all-trans-octaprenyl)phenol}}
+
{{#set: common-name=repressor lexa}}
{{#set: inchi-key=inchikey=margkpimnmaskj-cmaxttdksa-n}}
 
{{#set: molecular-weight=669.085}}
 

Latest revision as of 11:11, 17 October 2022

Metabolite repressor-LexA

  • common-name:
    • repressor lexa

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality