Difference between revisions of "P-NITROPHENOL"

Latest revision as of 11:12, 17 October 2022

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite 4-CYTIDINE-5-DIPHOSPHO-2-C ==
+== Metabolite P-NITROPHENOL ==
 * common-name:
-** 4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol
+** 4-nitrophenol
 * inchi-key:
-** yfaukwznpvbcff-xhibxcghsa-l
+** btjiuguipkrlhp-uhfffaoysa-m
 * molecular-weight:
-** 519.295
+** 138.102
 * smiles:
-** c[c@](o)(co)[c@h](o)cop(op([o-])(=o)oc[c@h]2([c@h]([c@@h](o)[c@h](n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o
+** c1(\c=c([o-])c=cc(\[n+](=o)[o-])=1)
 == Reaction(s) known to consume the compound ==
-* [[2.7.1.148-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[2.7.7.60-RXN]]
+* [[RXN-17830]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol}}
+{{#set: common-name=4-nitrophenol}}
-{{#set: inchi-key=inchikey=yfaukwznpvbcff-xhibxcghsa-l}}
+{{#set: inchi-key=inchikey=btjiuguipkrlhp-uhfffaoysa-m}}
-{{#set: molecular-weight=519.295}}
+{{#set: molecular-weight=138.102}}