Difference between revisions of "UBIQUINONE-6"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite FORMALDEHYDE == * common-name: ** formaldehyde * inchi-key: ** wsfssnumvmoomr-uhfffaoysa-n * molecular-weight: ** 30.026 * smiles: ** [ch...") |
(Created page with "Category:metabolite == Metabolite UBIQUINONE-6 == * common-name: ** ubiquinone-6 * inchi-key: ** gxnfpeoukfotky-lphqiwjtsa-n * molecular-weight: ** 590.885 * smiles: ** cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite UBIQUINONE-6 == |
* common-name: | * common-name: | ||
| − | ** | + | ** ubiquinone-6 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** gxnfpeoukfotky-lphqiwjtsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 590.885 |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(/c(c(/oc)=c(c(=o)c(\c)=1)/oc)=o) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[SUCCINATE-DEHYDROGENASE-UBIQUINONE6-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=ubiquinone-6}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gxnfpeoukfotky-lphqiwjtsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=590.885}} |
Latest revision as of 11:12, 17 October 2022
Contents
Metabolite UBIQUINONE-6
- common-name:
- ubiquinone-6
- inchi-key:
- gxnfpeoukfotky-lphqiwjtsa-n
- molecular-weight:
- 590.885
- smiles:
- cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(/c(c(/oc)=c(c(=o)c(\c)=1)/oc)=o)
