Difference between revisions of "2-ACETO-2-HYDROXY-BUTYRATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Odd-Saturated-Fatty-Acyl-CoA == * common-name: ** an odd numbered straight chain 2,3,4-saturated fatty acyl coa == Reaction(s) known to c...")
(Created page with "Category:metabolite == Metabolite 2-ACETO-2-HYDROXY-BUTYRATE == * common-name: ** (s)-2-aceto-2-hydroxybutanoate * inchi-key: ** vuqlhqfkacohnz-lurjtmiesa-m * molecular-we...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Odd-Saturated-Fatty-Acyl-CoA ==
+
== Metabolite 2-ACETO-2-HYDROXY-BUTYRATE ==
 
* common-name:
 
* common-name:
** an odd numbered straight chain 2,3,4-saturated fatty acyl coa
+
** (s)-2-aceto-2-hydroxybutanoate
 +
* inchi-key:
 +
** vuqlhqfkacohnz-lurjtmiesa-m
 +
* molecular-weight:
 +
** 145.135
 +
* smiles:
 +
** cc[c@@](o)(c(=o)[o-])c(c)=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ACETOOHBUTREDUCTOISOM-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-477]]
+
* [[ACETOOHBUTSYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an odd numbered straight chain 2,3,4-saturated fatty acyl coa}}
+
{{#set: common-name=(s)-2-aceto-2-hydroxybutanoate}}
 +
{{#set: inchi-key=inchikey=vuqlhqfkacohnz-lurjtmiesa-m}}
 +
{{#set: molecular-weight=145.135}}

Latest revision as of 11:14, 17 October 2022

Metabolite 2-ACETO-2-HYDROXY-BUTYRATE

  • common-name:
    • (s)-2-aceto-2-hydroxybutanoate
  • inchi-key:
    • vuqlhqfkacohnz-lurjtmiesa-m
  • molecular-weight:
    • 145.135
  • smiles:
    • cc[c@@](o)(c(=o)[o-])c(c)=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality