Difference between revisions of "PROTOPORPHYRINOGEN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DUDP == * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2)) * common-name: ** dudp * inchi-key: ** qhwztvccbmii...") |
(Created page with "Category:metabolite == Metabolite 2-KETO-3-METHYL-VALERATE == * smiles: ** ccc(c)c(=o)c([o-])=o * common-name: ** (s)-3-methyl-2-oxopentanoate * inchi-key: ** jvqyswduaoah...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-KETO-3-METHYL-VALERATE == |
* smiles: | * smiles: | ||
| − | ** c | + | ** ccc(c)c(=o)c([o-])=o |
* common-name: | * common-name: | ||
| − | ** | + | ** (s)-3-methyl-2-oxopentanoate |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jvqyswduaoahfm-bypyzucnsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 129.135 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]] |
| − | * [[ | + | * [[DIHYDROXYMETVALDEHYDRAT-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(s)-3-methyl-2-oxopentanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jvqyswduaoahfm-bypyzucnsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=129.135}} |
Revision as of 18:46, 23 November 2020
Contents
Metabolite 2-KETO-3-METHYL-VALERATE
- smiles:
- ccc(c)c(=o)c([o-])=o
- common-name:
- (s)-3-methyl-2-oxopentanoate
- inchi-key:
- jvqyswduaoahfm-bypyzucnsa-m
- molecular-weight:
- 129.135
