Difference between revisions of "D-galactopyranose"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2472 == * smiles: ** c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c(n)=o) * c...") |
(Created page with "Category:metabolite == Metabolite D-galactopyranose == * common-name: ** d-galactopyranose == Reaction(s) known to consume the compound == * ABC-18-RXN * RXN-14409...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite D-galactopyranose == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** d-galactopyranose |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[ABC-18-RXN]] | ||
| + | * [[RXN-14409]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[ABC-18-RXN]] |
| + | * [[ALPHAGALACTOSID-RXN]] | ||
| + | * [[RXN-14409]] | ||
| + | * [[RXN-17830]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-galactopyranose}} |
| − | |||
| − | |||
Latest revision as of 17:42, 15 January 2021
Contents
Metabolite D-galactopyranose
- common-name:
- d-galactopyranose
