Difference between revisions of "ITP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite D-ERYTHRO-IMIDAZOLE-GLYCEROL-P == * smiles: ** c1(nc=nc=1c(c(o)cop(=o)([o-])[o-])o) * common-name: ** d-erythro-imidazole-glycerol-phosph...")
(Created page with "Category:metabolite == Metabolite ITP == * smiles: ** c(op(=o)([o-])op([o-])(=o)op([o-])([o-])=o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * common-name: ** itp * inchi-ke...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite D-ERYTHRO-IMIDAZOLE-GLYCEROL-P ==
+
== Metabolite ITP ==
 
* smiles:
 
* smiles:
** c1(nc=nc=1c(c(o)cop(=o)([o-])[o-])o)
+
** c(op(=o)([o-])op([o-])(=o)op([o-])([o-])=o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
 
* common-name:
 
* common-name:
** d-erythro-imidazole-glycerol-phosphate
+
** itp
 
* inchi-key:
 
* inchi-key:
** hfybthcypkedqq-ritpcoansa-l
+
** haejpqiatwhalx-kqynxxcusa-j
 
* molecular-weight:
 
* molecular-weight:
** 236.121
+
** 504.137
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[IMIDPHOSDEHYD-RXN]]
+
* [[ADK4]]
 +
* [[CYTDK3]]
 +
* [[RXN-12481]]
 +
* [[RXN0-5073]]
 +
* [[RXN0-6382]]
 +
* [[URIK3]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLUTAMIDOTRANS-RXN]]
+
* [[ADK4]]
* [[RXN-17900]]
+
* [[RXN-12481]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-erythro-imidazole-glycerol-phosphate}}
+
{{#set: common-name=itp}}
{{#set: inchi-key=inchikey=hfybthcypkedqq-ritpcoansa-l}}
+
{{#set: inchi-key=inchikey=haejpqiatwhalx-kqynxxcusa-j}}
{{#set: molecular-weight=236.121}}
+
{{#set: molecular-weight=504.137}}

Latest revision as of 17:43, 15 January 2021

Metabolite ITP

  • smiles:
    • c(op(=o)([o-])op([o-])(=o)op([o-])([o-])=o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
  • common-name:
    • itp
  • inchi-key:
    • haejpqiatwhalx-kqynxxcusa-j
  • molecular-weight:
    • 504.137

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality