Difference between revisions of "D-ERYTHRO-IMIDAZOLE-GLYCEROL-P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ADP-D-GLYCERO-D-MANNO-HEPTOSE == * smiles: ** c(c([ch]4(oc(op(op(occ3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))([o-])=o)(=o)[o-])c(c(c4o)...") |
(Created page with "Category:metabolite == Metabolite D-ERYTHRO-IMIDAZOLE-GLYCEROL-P == * smiles: ** c1(nc=nc=1c(c(o)cop(=o)([o-])[o-])o) * common-name: ** d-erythro-imidazole-glycerol-phosph...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite D-ERYTHRO-IMIDAZOLE-GLYCEROL-P == |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(nc=nc=1c(c(o)cop(=o)([o-])[o-])o) |
* common-name: | * common-name: | ||
| − | ** | + | ** d-erythro-imidazole-glycerol-phosphate |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hfybthcypkedqq-ritpcoansa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 236.121 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[IMIDPHOSDEHYD-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[GLUTAMIDOTRANS-RXN]] |
| + | * [[RXN-17900]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-erythro-imidazole-glycerol-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hfybthcypkedqq-ritpcoansa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=236.121}} |
Latest revision as of 17:43, 15 January 2021
Contents
Metabolite D-ERYTHRO-IMIDAZOLE-GLYCEROL-P
- smiles:
- c1(nc=nc=1c(c(o)cop(=o)([o-])[o-])o)
- common-name:
- d-erythro-imidazole-glycerol-phosphate
- inchi-key:
- hfybthcypkedqq-ritpcoansa-l
- molecular-weight:
- 236.121
