Difference between revisions of "OH-ACYL-ACP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE == * smiles: ** cc(o)(co)c(o)cop([o-])([o-])=o * common-name: ** 2-c-methyl-d-erythritol 4-phosphate...") |
(Created page with "Category:metabolite == Metabolite OH-ACYL-ACP == * common-name: ** a (3r)-3-hydroxyacyl-[acyl-carrier protein] == Reaction(s) known to consume the compound == * 3-HYDROX...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite OH-ACYL-ACP == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** a (3r)-3-hydroxyacyl-[acyl-carrier protein] |
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[3-HYDROXYDECANOYL-ACP-DEHYDR-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[3-OXOACYL-ACP-REDUCT-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a (3r)-3-hydroxyacyl-[acyl-carrier protein]}} |
− | |||
− |
Latest revision as of 17:43, 15 January 2021
Contents
Metabolite OH-ACYL-ACP
- common-name:
- a (3r)-3-hydroxyacyl-[acyl-carrier protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a (3r)-3-hydroxyacyl-[acyl-carrier protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.