Difference between revisions of "O-UREIDOHOMOSERINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite FE+2 == * smiles: ** [fe++] * common-name: ** fe2+ * inchi-key: ** cwynvvgooaeacu-uhfffaoysa-n * molecular-weight: ** 55.847 == Reaction(...") |
(Created page with "Category:metabolite == Metabolite O-UREIDOHOMOSERINE == * smiles: ** c(cc(c(=o)[o-])[n+])onc(n)=o * common-name: ** o-ureidohomoserine * inchi-key: ** sfyvzosiaizwqu-vkhmy...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite O-UREIDOHOMOSERINE == |
* smiles: | * smiles: | ||
| − | ** [ | + | ** c(cc(c(=o)[o-])[n+])onc(n)=o |
* common-name: | * common-name: | ||
| − | ** | + | ** o-ureidohomoserine |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** sfyvzosiaizwqu-vkhmyheasa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 177.16 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=o-ureidohomoserine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=sfyvzosiaizwqu-vkhmyheasa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=177.16}} |
Latest revision as of 17:43, 15 January 2021
Contents
Metabolite O-UREIDOHOMOSERINE
- smiles:
- c(cc(c(=o)[o-])[n+])onc(n)=o
- common-name:
- o-ureidohomoserine
- inchi-key:
- sfyvzosiaizwqu-vkhmyheasa-n
- molecular-weight:
- 177.16
