Difference between revisions of "2-OCTAPRENYL-6-HYDROXYPHENOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Protein-Lysine-Aminocarbinol == * common-name: ** a [protein]-l-lysine-n-1-hydroxypropan-2-one == Reaction(s) known to consume the compou...") |
(Created page with "Category:metabolite == Metabolite 2-OCTAPRENYL-6-HYDROXYPHENOL == * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c * common...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-OCTAPRENYL-6-HYDROXYPHENOL == |
| + | * smiles: | ||
| + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c | ||
* common-name: | * common-name: | ||
| − | ** | + | ** 3-(all-trans-octaprenyl)benzene-1,2-diol |
| + | * inchi-key: | ||
| + | ** ynpgymzvnlizld-bqfktqoqsa-n | ||
| + | * molecular-weight: | ||
| + | ** 655.058 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[2-OCTAPRENYL-6-OHPHENOL-METHY-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-(all-trans-octaprenyl)benzene-1,2-diol}} |
| + | {{#set: inchi-key=inchikey=ynpgymzvnlizld-bqfktqoqsa-n}} | ||
| + | {{#set: molecular-weight=655.058}} | ||
Latest revision as of 17:43, 15 January 2021
Contents
Metabolite 2-OCTAPRENYL-6-HYDROXYPHENOL
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c
- common-name:
- 3-(all-trans-octaprenyl)benzene-1,2-diol
- inchi-key:
- ynpgymzvnlizld-bqfktqoqsa-n
- molecular-weight:
- 655.058
