Difference between revisions of "2-KETO-GLUTARAMATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DEAMIDO-NAD == * smiles: ** c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c([o-])...")
(Created page with "Category:metabolite == Metabolite 2-KETO-GLUTARAMATE == * common-name: ** 2-oxoglutaramate * inchi-key: ** cojbgnauusnxhx-uhfffaoysa-m * molecular-weight: ** 144.107 * smi...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DEAMIDO-NAD ==
+
== Metabolite 2-KETO-GLUTARAMATE ==
* smiles:
 
** c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c([o-])=o)
 
 
* common-name:
 
* common-name:
** nicotinate adenine dinucleotide
+
** 2-oxoglutaramate
 
* inchi-key:
 
* inchi-key:
** senpvezbrzqvst-hisdbwnosa-l
+
** cojbgnauusnxhx-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 662.399
+
** 144.107
 +
* smiles:
 +
** c(cc(n)=o)c(=o)c(=o)[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[NAD-SYNTH-GLN-RXN]]
+
* [[GLUTAMINE--PYRUVATE-AMINOTRANSFERASE-RXN]]
* [[NAD-SYNTH-NH3-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[NICONUCADENYLYLTRAN-RXN]]
+
* [[GLUTAMINE--PYRUVATE-AMINOTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=nicotinate adenine dinucleotide}}
+
{{#set: common-name=2-oxoglutaramate}}
{{#set: inchi-key=inchikey=senpvezbrzqvst-hisdbwnosa-l}}
+
{{#set: inchi-key=inchikey=cojbgnauusnxhx-uhfffaoysa-m}}
{{#set: molecular-weight=662.399}}
+
{{#set: molecular-weight=144.107}}

Latest revision as of 17:44, 15 January 2021

Metabolite 2-KETO-GLUTARAMATE

  • common-name:
    • 2-oxoglutaramate
  • inchi-key:
    • cojbgnauusnxhx-uhfffaoysa-m
  • molecular-weight:
    • 144.107
  • smiles:
    • c(cc(n)=o)c(=o)c(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality