Difference between revisions of "DIMP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1695 == * common-name: ** cobalt chloride * molecular-weight: ** 129.836 == Reaction(s) known to consume the compound == * Exchang...") |
(Created page with "Category:metabolite == Metabolite DIMP == * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23))) * common-name: ** dimp * inchi-key: ** phngfppxdjjadg-rrkc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DIMP == |
| + | * smiles: | ||
| + | ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23))) | ||
* common-name: | * common-name: | ||
| − | ** | + | ** dimp |
| + | * inchi-key: | ||
| + | ** phngfppxdjjadg-rrkcrqdmsa-l | ||
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 330.193 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[NTD12]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN0-1602]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dimp}} |
| − | {{#set: molecular-weight= | + | {{#set: inchi-key=inchikey=phngfppxdjjadg-rrkcrqdmsa-l}} |
| + | {{#set: molecular-weight=330.193}} | ||
Latest revision as of 17:44, 15 January 2021
Contents
Metabolite DIMP
- smiles:
- c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23)))
- common-name:
- dimp
- inchi-key:
- phngfppxdjjadg-rrkcrqdmsa-l
- molecular-weight:
- 330.193
