Difference between revisions of "CPDQT-36"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite RIBOSE-5P == * common-name: ** d-ribose 5-phosphate == Reaction(s) known to consume the compound == * 1TRANSKETO-RXN * PPENTOMUT-RX...") |
(Created page with "Category:metabolite == Metabolite CPDQT-36 == * smiles: ** c(c(cccsc)c(o)c(=o)[o-])(=o)[o-] * common-name: ** 3-(3'-methylthio)propylmalate * inchi-key: ** sqxviiopmysncp-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPDQT-36 == |
| + | * smiles: | ||
| + | ** c(c(cccsc)c(o)c(=o)[o-])(=o)[o-] | ||
* common-name: | * common-name: | ||
| − | ** | + | ** 3-(3'-methylthio)propylmalate |
| + | * inchi-key: | ||
| + | ** sqxviiopmysncp-uhfffaoysa-l | ||
| + | * molecular-weight: | ||
| + | ** 220.24 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-18208]] |
| − | + | * [[RXNQT-4165]] | |
| − | * [[ | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-18208]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-(3'-methylthio)propylmalate}} |
| + | {{#set: inchi-key=inchikey=sqxviiopmysncp-uhfffaoysa-l}} | ||
| + | {{#set: molecular-weight=220.24}} | ||
Latest revision as of 17:44, 15 January 2021
Contents
Metabolite CPDQT-36
- smiles:
- c(c(cccsc)c(o)c(=o)[o-])(=o)[o-]
- common-name:
- 3-(3'-methylthio)propylmalate
- inchi-key:
- sqxviiopmysncp-uhfffaoysa-l
- molecular-weight:
- 220.24
