Difference between revisions of "CPD-14553"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N-acetyl-beta-D-hexosamines == * common-name: ** an n-acetyl-β-d-hexosamine == Reaction(s) known to consume the compound == == React...")
(Created page with "Category:metabolite == Metabolite CPD-14553 == * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o) * common-name: ** udp-&...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N-acetyl-beta-D-hexosamines ==
+
== Metabolite CPD-14553 ==
 +
* smiles:
 +
** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)
 
* common-name:
 
* common-name:
** an n-acetyl-β-d-hexosamine
+
** udp-α-d-galactose
 +
* inchi-key:
 +
** hscjrczfdfqwrp-abvwguqpsa-l
 +
* molecular-weight:
 +
** 564.289
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[GALACTURIDYLYLTRANS-RXN]]
 +
* [[GALPMUT-RXN]]
 +
* [[UDPGLUCEPIM-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.2.1.52-RXN]]
+
* [[GALACTURIDYLYLTRANS-RXN]]
 +
* [[GALPMUT-RXN]]
 +
* [[UDPGLUCEPIM-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an n-acetyl-β-d-hexosamine}}
+
{{#set: common-name=udp-α-d-galactose}}
 +
{{#set: inchi-key=inchikey=hscjrczfdfqwrp-abvwguqpsa-l}}
 +
{{#set: molecular-weight=564.289}}

Latest revision as of 17:44, 15 January 2021

Metabolite CPD-14553

  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)
  • common-name:
    • udp-α-d-galactose
  • inchi-key:
    • hscjrczfdfqwrp-abvwguqpsa-l
  • molecular-weight:
    • 564.289

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality