Difference between revisions of "KCL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite C-DI-GMP == * smiles: ** c1(c7(c(op([o-])(=o)occ4(c(op([o-])(=o)o1)c(o)c(n3(c2(n=c(n)nc(=o)c=2n=c3)))o4))c(o)c(n6(c5(n=c(n)nc(=o)c=5n=c6)...")
(Created page with "Category:metabolite == Metabolite KCL == * common-name: ** potassium chloride * molecular-weight: ** 74.551 == Reaction(s) known to consume the compound == * ExchangeSee...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite C-DI-GMP ==
+
== Metabolite KCL ==
* smiles:
 
** c1(c7(c(op([o-])(=o)occ4(c(op([o-])(=o)o1)c(o)c(n3(c2(n=c(n)nc(=o)c=2n=c3)))o4))c(o)c(n6(c5(n=c(n)nc(=o)c=5n=c6)))o7))
 
 
* common-name:
 
* common-name:
** cyclic di-3',5'-guanylate
+
** potassium chloride
* inchi-key:
 
** pkfdlksezwefgl-mharetsrsa-l
 
 
* molecular-weight:
 
* molecular-weight:
** 688.4
+
** 74.551
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ExchangeSeed-KCL]]
 +
* [[TransportSeed-KCL]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-5359]]
+
* [[ExchangeSeed-KCL]]
 +
* [[TransportSeed-KCL]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cyclic di-3',5'-guanylate}}
+
{{#set: common-name=potassium chloride}}
{{#set: inchi-key=inchikey=pkfdlksezwefgl-mharetsrsa-l}}
+
{{#set: molecular-weight=74.551}}
{{#set: molecular-weight=688.4}}
 

Latest revision as of 17:44, 15 January 2021

Metabolite KCL

  • common-name:
    • potassium chloride
  • molecular-weight:
    • 74.551

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality