Difference between revisions of "CPD-14927"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SHIKIMATE-5P == * smiles: ** c(=o)([o-])c1(=cc(op(=o)([o-])[o-])c(o)c(o)c1) * common-name: ** shikimate 3-phosphate * inchi-key: ** qyojs...") |
(Created page with "Category:metabolite == Metabolite CPD-14927 == * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=cc(=o)[o-] * common-name: ** phytenate * inchi-key: ** wdwbnnbrpveeod-pfxvradusa-m *...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-14927 == |
* smiles: | * smiles: | ||
− | ** c( | + | ** cc(c)cccc(c)cccc(c)cccc(c)=cc(=o)[o-] |
* common-name: | * common-name: | ||
− | ** | + | ** phytenate |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** wdwbnnbrpveeod-pfxvradusa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 309.511 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN66-480]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=phytenate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wdwbnnbrpveeod-pfxvradusa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=309.511}} |
Latest revision as of 17:45, 15 January 2021
Contents
Metabolite CPD-14927
- smiles:
- cc(c)cccc(c)cccc(c)cccc(c)=cc(=o)[o-]
- common-name:
- phytenate
- inchi-key:
- wdwbnnbrpveeod-pfxvradusa-m
- molecular-weight:
- 309.511