Difference between revisions of "Red-Thioredoxin"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17373 == * smiles: ** c(o)cccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccco)cop([o-])(=o)[o-])=o * common-name: ** 1-[18-hydroxyoeoyl...") |
(Created page with "Category:metabolite == Metabolite Red-Thioredoxin == * common-name: ** a reduced thioredoxin == Reaction(s) known to consume the compound == * CDPREDUCT-RXN * [[RNTR1]...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Red-Thioredoxin == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** a reduced thioredoxin |
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[CDPREDUCT-RXN]] | ||
+ | * [[RNTR1]] | ||
+ | * [[RNTR2]] | ||
+ | * [[RNTR3]] | ||
+ | * [[RNTR4]] | ||
+ | * [[RXN0-267]] | ||
+ | * [[THIOREDOXIN-RXN]] | ||
+ | * [[TRDRr]] | ||
+ | * [[UDPREDUCT-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[THIOREDOXIN-REDUCT-NADPH-RXN]] |
+ | * [[TRDRr]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a reduced thioredoxin}} |
− | |||
− |
Latest revision as of 17:45, 15 January 2021
Contents
Metabolite Red-Thioredoxin
- common-name:
- a reduced thioredoxin