Difference between revisions of "CPD-7323"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ALA-tRNAs == * common-name: ** a trnaala == Reaction(s) known to consume the compound == * ALANINE--TRNA-LIGASE-RXN == Reaction(s) kn...") |
(Created page with "Category:metabolite == Metabolite CPD-7323 == * smiles: ** cc(c)=cccc(=cccc(=cccc(c)=cccc(ccoc2(=cc1(n=c3(c(=nc=1c=c2)c=cc=c3))))c)c)c * common-name: ** methanophenazine *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7323 == |
| + | * smiles: | ||
| + | ** cc(c)=cccc(=cccc(=cccc(c)=cccc(ccoc2(=cc1(n=c3(c(=nc=1c=c2)c=cc=c3))))c)c)c | ||
* common-name: | * common-name: | ||
| − | ** | + | ** methanophenazine |
| + | * inchi-key: | ||
| + | ** vrhmbacmyzitgd-qaaqoenvsa-n | ||
| + | * molecular-weight: | ||
| + | ** 538.815 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[1.8.98.1-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[1.8.98.1-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=methanophenazine}} |
| + | {{#set: inchi-key=inchikey=vrhmbacmyzitgd-qaaqoenvsa-n}} | ||
| + | {{#set: molecular-weight=538.815}} | ||
Latest revision as of 17:45, 15 January 2021
Contents
Metabolite CPD-7323
- smiles:
- cc(c)=cccc(=cccc(=cccc(c)=cccc(ccoc2(=cc1(n=c3(c(=nc=1c=c2)c=cc=c3))))c)c)c
- common-name:
- methanophenazine
- inchi-key:
- vrhmbacmyzitgd-qaaqoenvsa-n
- molecular-weight:
- 538.815
