Difference between revisions of "CPD-18396"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-AMP == * smiles: ** c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop([o-])(=o)[o-])o)o))c=n2)n=c3))=n))o4)o)o))op([o-])([o-])=o * c...")
(Created page with "Category:metabolite == Metabolite CPD-18396 == * smiles: ** ccccccc=ccccccccccc(occ(oc(=o)cccccccccc=ccccccc)cop([o-])(=o)occ(o)co)=o * common-name: ** phosphatidylglycero...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHOSPHORIBOSYL-AMP ==
+
== Metabolite CPD-18396 ==
 
* smiles:
 
* smiles:
** c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop([o-])(=o)[o-])o)o))c=n2)n=c3))=n))o4)o)o))op([o-])([o-])=o
+
** ccccccc=ccccccccccc(occ(oc(=o)cccccccccc=ccccccc)cop([o-])(=o)occ(o)co)=o
 
* common-name:
 
* common-name:
** 1-(5-phospho-β-d-ribosyl)-amp
+
** phosphatidylglycerol (dioctadec-11-enoyl, n-c18:1)
 
* inchi-key:
 
* inchi-key:
** rtqmrtsptliihm-keohhstqsa-j
+
** solxjhkvrwsnjx-zkixvcmusa-m
 
* molecular-weight:
 
* molecular-weight:
** 555.288
+
** 774.046
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HISTCYCLOHYD-RXN]]
+
* [[CLPNS181]]
 +
* [[CLPNS181pp]]
 +
* [[PG181abcpp]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HISTPRATPHYD-RXN]]
+
* [[CLPNS181]]
 +
* [[CLPNS181pp]]
 +
* [[PG181abcpp]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-(5-phospho-β-d-ribosyl)-amp}}
+
{{#set: common-name=phosphatidylglycerol (dioctadec-11-enoyl, n-c18:1)}}
{{#set: inchi-key=inchikey=rtqmrtsptliihm-keohhstqsa-j}}
+
{{#set: inchi-key=inchikey=solxjhkvrwsnjx-zkixvcmusa-m}}
{{#set: molecular-weight=555.288}}
+
{{#set: molecular-weight=774.046}}

Latest revision as of 17:45, 15 January 2021

Metabolite CPD-18396

  • smiles:
    • ccccccc=ccccccccccc(occ(oc(=o)cccccccccc=ccccccc)cop([o-])(=o)occ(o)co)=o
  • common-name:
    • phosphatidylglycerol (dioctadec-11-enoyl, n-c18:1)
  • inchi-key:
    • solxjhkvrwsnjx-zkixvcmusa-m
  • molecular-weight:
    • 774.046

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality