Difference between revisions of "CPD-18396"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-AMP == * smiles: ** c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop([o-])(=o)[o-])o)o))c=n2)n=c3))=n))o4)o)o))op([o-])([o-])=o * c...") |
(Created page with "Category:metabolite == Metabolite CPD-18396 == * smiles: ** ccccccc=ccccccccccc(occ(oc(=o)cccccccccc=ccccccc)cop([o-])(=o)occ(o)co)=o * common-name: ** phosphatidylglycero...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-18396 == |
* smiles: | * smiles: | ||
− | ** | + | ** ccccccc=ccccccccccc(occ(oc(=o)cccccccccc=ccccccc)cop([o-])(=o)occ(o)co)=o |
* common-name: | * common-name: | ||
− | ** | + | ** phosphatidylglycerol (dioctadec-11-enoyl, n-c18:1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** solxjhkvrwsnjx-zkixvcmusa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 774.046 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[CLPNS181]] |
+ | * [[CLPNS181pp]] | ||
+ | * [[PG181abcpp]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[CLPNS181]] |
+ | * [[CLPNS181pp]] | ||
+ | * [[PG181abcpp]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=phosphatidylglycerol (dioctadec-11-enoyl, n-c18:1)}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=solxjhkvrwsnjx-zkixvcmusa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=774.046}} |
Latest revision as of 17:45, 15 January 2021
Contents
Metabolite CPD-18396
- smiles:
- ccccccc=ccccccccccc(occ(oc(=o)cccccccccc=ccccccc)cop([o-])(=o)occ(o)co)=o
- common-name:
- phosphatidylglycerol (dioctadec-11-enoyl, n-c18:1)
- inchi-key:
- solxjhkvrwsnjx-zkixvcmusa-m
- molecular-weight:
- 774.046