Difference between revisions of "LysW-L-glutamate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CYTIDINE == * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))o * common-name: ** cytidine * inchi-key: ** uhdgcwiwmrvcdj-xvfcmesisa-n...")
(Created page with "Category:metabolite == Metabolite LysW-L-glutamate == * common-name: ** an [l-2-aminoadipate carrier protein]-l-glutamate == Reaction(s) known to consume the compound == *...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CYTIDINE ==
+
== Metabolite LysW-L-glutamate ==
* smiles:
 
** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))o
 
 
* common-name:
 
* common-name:
** cytidine
+
** an [l-2-aminoadipate carrier protein]-l-glutamate
* inchi-key:
 
** uhdgcwiwmrvcdj-xvfcmesisa-n
 
* molecular-weight:
 
** 243.219
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CYTDK3]]
+
* [[RXN-15005]]
* [[CYTDK4]]
 
* [[CYTIDEAM2-RXN]]
 
* [[CYTIDINEKIN-RXN]]
 
* [[CYTIKIN-RXN]]
 
* [[RXN0-361]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[NADK2]]
 
* [[PYNP1]]
 
* [[RXN-14026]]
 
* [[URIK9]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cytidine}}
+
{{#set: common-name=an [l-2-aminoadipate carrier protein]-l-glutamate}}
{{#set: inchi-key=inchikey=uhdgcwiwmrvcdj-xvfcmesisa-n}}
 
{{#set: molecular-weight=243.219}}
 

Latest revision as of 17:45, 15 January 2021

Metabolite LysW-L-glutamate

  • common-name:
    • an [l-2-aminoadipate carrier protein]-l-glutamate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an [l-2-aminoadipate carrier protein]-l-glutamate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.