Difference between revisions of "D-GALACTOSAMINE-6-PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2279 == * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop([o-])(=o)op([o-])(=o)oc4(oc(c(o)c(...") |
(Created page with "Category:metabolite == Metabolite D-GALACTOSAMINE-6-PHOSPHATE == * smiles: ** c(op(=o)([o-])[o-])c1(oc(o)c([n+])c(o)c(o)1) * common-name: ** d-galactosamine 6-phosphate *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite D-GALACTOSAMINE-6-PHOSPHATE == |
* smiles: | * smiles: | ||
| − | ** | + | ** c(op(=o)([o-])[o-])c1(oc(o)c([n+])c(o)c(o)1) |
* common-name: | * common-name: | ||
| − | ** | + | ** d-galactosamine 6-phosphate |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xhmjouiafhjhbw-gasjemhnsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 258.144 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[AGDC2]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-galactosamine 6-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xhmjouiafhjhbw-gasjemhnsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=258.144}} |
Latest revision as of 17:45, 15 January 2021
Contents
Metabolite D-GALACTOSAMINE-6-PHOSPHATE
- smiles:
- c(op(=o)([o-])[o-])c1(oc(o)c([n+])c(o)c(o)1)
- common-name:
- d-galactosamine 6-phosphate
- inchi-key:
- xhmjouiafhjhbw-gasjemhnsa-m
- molecular-weight:
- 258.144
