Difference between revisions of "CPD-157"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite E- == == Reaction(s) known to consume the compound == * RXN-15468 * RXN-924 * RXN0-5257 * RXN0-5259 == Reaction(s) known...") |
(Created page with "Category:metabolite == Metabolite CPD-157 == * smiles: ** c([o-])(=o)ccc(=o)c=cc=c(c([o-])=o)o * common-name: ** (2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate * inchi-k...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-157 == |
| + | * smiles: | ||
| + | ** c([o-])(=o)ccc(=o)c=cc=c(c([o-])=o)o | ||
| + | * common-name: | ||
| + | ** (2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate | ||
| + | * inchi-key: | ||
| + | ** rfenovfrmprrji-ydcwotkksa-l | ||
| + | * molecular-weight: | ||
| + | ** 212.159 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[MHPCHYDROL-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=(2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate}} | ||
| + | {{#set: inchi-key=inchikey=rfenovfrmprrji-ydcwotkksa-l}} | ||
| + | {{#set: molecular-weight=212.159}} | ||
Latest revision as of 17:45, 15 January 2021
Contents
Metabolite CPD-157
- smiles:
- c([o-])(=o)ccc(=o)c=cc=c(c([o-])=o)o
- common-name:
- (2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate
- inchi-key:
- rfenovfrmprrji-ydcwotkksa-l
- molecular-weight:
- 212.159
