Difference between revisions of "N-ACETYL-D-GLUCOSAMINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HIS-tRNAs == * common-name: ** a trnahis == Reaction(s) known to consume the compound == * HISTIDINE--TRNA-LIGASE-RXN == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite N-ACETYL-D-GLUCOSAMINE == * smiles: ** cc(=o)nc1(c(o)oc(co)c(o)c(o)1) * common-name: ** n-acetyl-β-d-glucosamine * inchi-key: ** ovr...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-ACETYL-D-GLUCOSAMINE == |
| + | * smiles: | ||
| + | ** cc(=o)nc1(c(o)oc(co)c(o)c(o)1) | ||
* common-name: | * common-name: | ||
| − | ** | + | ** n-acetyl-β-d-glucosamine |
| + | * inchi-key: | ||
| + | ** ovrndrqmdrjths-fmdgeedcsa-n | ||
| + | * molecular-weight: | ||
| + | ** 221.21 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN0-5226]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-acetyl-β-d-glucosamine}} |
| + | {{#set: inchi-key=inchikey=ovrndrqmdrjths-fmdgeedcsa-n}} | ||
| + | {{#set: molecular-weight=221.21}} | ||
Latest revision as of 17:45, 15 January 2021
Contents
Metabolite N-ACETYL-D-GLUCOSAMINE
- smiles:
- cc(=o)nc1(c(o)oc(co)c(o)c(o)1)
- common-name:
- n-acetyl-β-d-glucosamine
- inchi-key:
- ovrndrqmdrjths-fmdgeedcsa-n
- molecular-weight:
- 221.21
