Difference between revisions of "PRO-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12826 == * smiles: ** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c2(c=nc3(n=c(n)nc(=o)c(n=2)=3)) * common-name: ** folate * inch...") |
(Created page with "Category:metabolite == Metabolite PRO-tRNAs == * common-name: ** a trnapro == Reaction(s) known to consume the compound == * PROLINE--TRNA-LIGASE-RXN == Reaction(s) kn...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PRO-tRNAs == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** a trnapro |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[PROLINE--TRNA-LIGASE-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a trnapro}} |
| − | |||
| − | |||
Latest revision as of 17:45, 15 January 2021
Contents
Metabolite PRO-tRNAs
- common-name:
- a trnapro
