Difference between revisions of "CPD-824"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-824 == * common-name: ** 5-guanidino-2-oxopentanoate * inchi-key: ** arbhxjxxvvhmet-uhfffaoysa-n * molecular-weight: ** 173.171 * smi...") |
(Created page with "Category:metabolite == Metabolite CPD-824 == * common-name: ** 5-guanidino-2-oxopentanoate * inchi-key: ** arbhxjxxvvhmet-uhfffaoysa-n * molecular-weight: ** 173.171 * smi...") |
(No difference)
|
Latest revision as of 17:46, 15 January 2021
Contents
Metabolite CPD-824
- common-name:
- 5-guanidino-2-oxopentanoate
- inchi-key:
- arbhxjxxvvhmet-uhfffaoysa-n
- molecular-weight:
- 173.171
- smiles:
- c(c(cccnc(=[n+])n)=o)(=o)[o-]