Difference between revisions of "CPD-15382"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PRISTANATE == * smiles: ** cc(cccc(cccc(c)cccc(c([o-])=o)c)c)c * common-name: ** pristanate * inchi-key: ** pahgjzdqxioyth-uhfffaoysa-m *...") |
(Created page with "Category:metabolite == Metabolite CPD-15382 == * smiles: ** c(o)c(=o)c(o)c(o)c(o)co * common-name: ** keto-d-fructose * inchi-key: ** bjhikxhvcxfqls-uyfozjqfsa-n * molecul...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-15382 == |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c(=o)c(o)c(o)c(o)co |
* common-name: | * common-name: | ||
| − | ** | + | ** keto-d-fructose |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** bjhikxhvcxfqls-uyfozjqfsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 180.157 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[GLUCISOM-RXN]] |
| + | * [[RXN-14515]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[GLUCISOM-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=keto-d-fructose}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bjhikxhvcxfqls-uyfozjqfsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=180.157}} |
Latest revision as of 17:46, 15 January 2021
Contents
Metabolite CPD-15382
- smiles:
- c(o)c(=o)c(o)c(o)c(o)co
- common-name:
- keto-d-fructose
- inchi-key:
- bjhikxhvcxfqls-uyfozjqfsa-n
- molecular-weight:
- 180.157
