Difference between revisions of "CPD0-2244"
Jump to navigation
Jump to search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-7-DIMETHYLXANTHINE 1-7-DIMETHYLXANTHINE] == * common name: ** paraxanthine * inchi key: ** In...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2244 CPD0-2244] == * common name: ** (S)-3-hydroxydecanoyl-CoA * inchi key: ** InChIKey=HI...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2244 CPD0-2244] == |
* common name: | * common name: | ||
| − | ** | + | ** (S)-3-hydroxydecanoyl-CoA |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=HIVSMYZAMUNFKZ-PNPVFPMQSA-J |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 933.753 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-12490]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-13616]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859629 49859629] |
| − | * REFMET : | + | * HMDB : HMDB03938 |
| + | * BIGG : 3hdcoa | ||
| + | * REFMET : 3-hydroxydecanoyl-CoA | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05264 C05264] |
| − | * | + | * CHEBI: |
| − | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62616 62616] |
| − | {{#set: common name= | + | {{#set: common name=(S)-3-hydroxydecanoyl-CoA}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=HIVSMYZAMUNFKZ-PNPVFPMQSA-J}} |
| − | {{#set: smiles= | + | {{#set: smiles=CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=933.753 }} |
| − | {{#set: | + | {{#set: consumed by=RXN-12490}} |
| − | {{#set: produced by= | + | {{#set: produced by=RXN-13616}} |
Latest revision as of 14:17, 15 January 2021
Contents
Metabolite CPD0-2244
- common name:
- (S)-3-hydroxydecanoyl-CoA
- inchi key:
- InChIKey=HIVSMYZAMUNFKZ-PNPVFPMQSA-J
- smiles:
- CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
- molecular weight:
- 933.753
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB03938
- BIGG : 3hdcoa
- REFMET : 3-hydroxydecanoyl-CoA
- LIGAND-CPD:
- CHEBI:
Property "Smiles" (as page type) with input value "CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
