Difference between revisions of "CPD-8607"
Jump to navigation
Jump to search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-COA ACETYL-COA] == * common name: ** acetyl-CoA * inchi key: ** InChIKey=ZSLZBFCDCINBPY-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8607 CPD-8607] == * common name: ** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8607 CPD-8607] == |
* common name: | * common name: | ||
− | ** | + | ** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=SJPDNXKPBQHPMZ-PUXRVUTHSA-N |
* smiles: | * smiles: | ||
− | ** CC( | + | ** CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 444.74 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN66-12]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN66-11]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15698821 15698821] |
− | + | * HMDB : HMDB12160 | |
− | * HMDB : | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87057 87057] |
− | {{#set: common name= | + | {{#set: common name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=SJPDNXKPBQHPMZ-PUXRVUTHSA-N}} |
− | {{#set: smiles=CC( | + | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=444.74 }} |
− | + | {{#set: consumed by=RXN66-12}} | |
− | {{#set: consumed by= | + | {{#set: produced by=RXN66-11}} |
− | {{#set: produced by= | ||
− |
Latest revision as of 14:17, 15 January 2021
Contents
Metabolite CPD-8607
- common name:
- 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol
- inchi key:
- InChIKey=SJPDNXKPBQHPMZ-PUXRVUTHSA-N
- smiles:
- CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
- molecular weight:
- 444.74
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
Property "Smiles" (as page type) with input value "CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.