Difference between revisions of "DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE"
Jump to navigation
Jump to search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN-tRNAs ASN-tRNAs] == * common name: ** tRNAAsn * Synonym(s): ** TRNA(ASN) == Reaction(s) kn...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE] == * common name: **...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE] == |
* common name: | * common name: | ||
− | ** | + | ** (S)-2,3,4,5-tetrahydrodipicolinate |
+ | * inchi key: | ||
+ | ** InChIKey=CXMBCXQHOXUCEO-BYPYZUCNSA-L | ||
+ | * smiles: | ||
+ | ** C1(CC(=NC(C1)C([O-])=O)C([O-])=O) | ||
+ | * molecular weight: | ||
+ | ** 169.137 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 2,3,4,5-tetrahydrodipicolinate |
+ | ** (S)-2,3,4,5-tetrahydropyridine-2,6-dicarboxylate | ||
+ | ** Δ1-piperideine-2,6-dicarboxylate | ||
+ | ** tetrahydrodipicolinate | ||
+ | ** tetrahydropyridine-2,6-dicarboxylate | ||
+ | ** L-2,3,4,5-tetrahydrodipicolinate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-14014]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-7737]] | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460405 5460405] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C03972 C03972] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4573939.html 4573939] | ||
+ | * CAS : 52-52-8 | ||
+ | * BIGG : thdp | ||
+ | * HMDB : HMDB12289 | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16845 16845] | ||
+ | {{#set: common name=(S)-2,3,4,5-tetrahydrodipicolinate}} | ||
+ | {{#set: inchi key=InChIKey=CXMBCXQHOXUCEO-BYPYZUCNSA-L}} | ||
+ | {{#set: smiles=C1(CC(=NC(C1)C([O-])=O)C([O-])=O)}} | ||
+ | {{#set: molecular weight=169.137 }} | ||
+ | {{#set: common name=2,3,4,5-tetrahydrodipicolinate|(S)-2,3,4,5-tetrahydropyridine-2,6-dicarboxylate|Δ1-piperideine-2,6-dicarboxylate|tetrahydrodipicolinate|tetrahydropyridine-2,6-dicarboxylate|L-2,3,4,5-tetrahydrodipicolinate}} | ||
+ | {{#set: produced by=RXN-14014}} | ||
+ | {{#set: reversible reaction associated=RXN-7737}} |
Latest revision as of 14:17, 15 January 2021
Contents
Metabolite DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE
- common name:
- (S)-2,3,4,5-tetrahydrodipicolinate
- inchi key:
- InChIKey=CXMBCXQHOXUCEO-BYPYZUCNSA-L
- smiles:
- C1(CC(=NC(C1)C([O-])=O)C([O-])=O)
- molecular weight:
- 169.137
- Synonym(s):
- 2,3,4,5-tetrahydrodipicolinate
- (S)-2,3,4,5-tetrahydropyridine-2,6-dicarboxylate
- Δ1-piperideine-2,6-dicarboxylate
- tetrahydrodipicolinate
- tetrahydropyridine-2,6-dicarboxylate
- L-2,3,4,5-tetrahydrodipicolinate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- LIGAND-CPD:
- CHEMSPIDER:
- CAS : 52-52-8
- BIGG : thdp
- HMDB : HMDB12289
- CHEBI:
Property "Smiles" (as page type) with input value "C1(CC(=NC(C1)C([O-])=O)C([O-])=O)" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.