Difference between revisions of "2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23-DIPHOSPHOGLYCERATE 23-DIPHOSPHOGLYCERATE] == * common name: ** 2,3-diphospho-D-glycerate * i...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE 2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE] == * common name: ** 2...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE 2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE] == |
* common name: | * common name: | ||
− | ** 2 | + | ** 2-C-methyl-D-erythritol 4-phosphate |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=XMWHRVNVKDKBRG-UHNVWZDZSA-L |
* smiles: | * smiles: | ||
− | ** | + | ** CC(O)(CO)C(O)COP([O-])([O-])=O |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 214.111 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** MEP |
− | + | ** 2-methylerylthritol 4-phosphate | |
− | |||
− | ** 2 | ||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[2.7.7.60-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[DXPREDISOM-RXN]] |
− | |||
− | |||
− | |||
== External links == | == External links == | ||
− | * | + | * BIGG : 2me4p |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21608483 21608483] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.10645747.html 10645747] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11434 C11434] |
− | |||
− | |||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58262 58262] |
− | {{#set: common name=2 | + | {{#set: common name=2-C-methyl-D-erythritol 4-phosphate}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=XMWHRVNVKDKBRG-UHNVWZDZSA-L}} |
− | {{#set: smiles= | + | {{#set: smiles=CC(O)(CO)C(O)COP([O-])([O-])=O}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=214.111 }} |
− | {{#set: common name= | + | {{#set: common name=MEP|2-methylerylthritol 4-phosphate}} |
− | {{#set: reversible reaction associated= | + | {{#set: consumed by=2.7.7.60-RXN}} |
+ | {{#set: reversible reaction associated=DXPREDISOM-RXN}} |
Latest revision as of 14:18, 15 January 2021
Contents
Metabolite 2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE
- common name:
- 2-C-methyl-D-erythritol 4-phosphate
- inchi key:
- InChIKey=XMWHRVNVKDKBRG-UHNVWZDZSA-L
- smiles:
- CC(O)(CO)C(O)COP([O-])([O-])=O
- molecular weight:
- 214.111
- Synonym(s):
- MEP
- 2-methylerylthritol 4-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
Property "Smiles" (as page type) with input value "CC(O)(CO)C(O)COP([O-])([O-])=O" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.