Difference between revisions of "11Z-icos-11-enoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11519 CPD-11519] == * common name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3R-hydroxyo...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=11Z-icos-11-enoyl-ACPs 11Z-icos-11-enoyl-ACPs] == * common name: ** a gondoyl-[acp] * Synonym(s...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11519 CPD-11519] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=11Z-icos-11-enoyl-ACPs 11Z-icos-11-enoyl-ACPs] ==
 
* common name:
 
* common name:
−
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3R-hydroxyoctanoyl)-CoA
+
** a gondoyl-[acp]
−
* inchi key:
 
−
** InChIKey=PDDHCVXPABQISO-XJJFHSEKSA-J
 
−
* smiles:
 
−
** CCC=CCC1(C(CCC(=O)1)CCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-])=O)
 
−
* molecular weight:
 
−
** 1055.92   
 
 
* Synonym(s):
 
* Synonym(s):
−
** OPC8-3-hydroxyacyl-CoA
+
** an (11Z)-icos-11-enoyl-[acp]
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-10698]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-10697]]
+
* [[RXN-16632]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a gondoyl-[acp]}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=126961152 126961152]
+
{{#set: common name=an (11Z)-icos-11-enoyl-[acp]}}
−
{{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3R-hydroxyoctanoyl)-CoA}}
+
{{#set: produced by=RXN-16632}}
−
{{#set: inchi key=InChIKey=PDDHCVXPABQISO-XJJFHSEKSA-J}}
 
−
{{#set: smiles=CCC=CCC1(C(CCC(=O)1)CCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-])=O)}}
 
−
{{#set: molecular weight=1055.92    }}
 
−
{{#set: common name=OPC8-3-hydroxyacyl-CoA}}
 
−
{{#set: consumed by=RXN-10698}}
 
−
{{#set: produced by=RXN-10697}}
 

Latest revision as of 14:18, 15 January 2021

Metabolite 11Z-icos-11-enoyl-ACPs

  • common name:
    • a gondoyl-[acp]
  • Synonym(s):
    • an (11Z)-icos-11-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Property "Common name" (as page type) with input value "a gondoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process. Property "Common name" (as page type) with input value "an (11Z)-icos-11-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.

Retrieved from "http://gem-aureme.genouest.org//ucomgem/index.php?title=11Z-icos-11-enoyl-ACPs&oldid=6841"