Difference between revisions of "XANTHINE"
Jump to navigation
Jump to search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7Z-3-oxo-hexadec-7-enoyl-ACPs 7Z-3-oxo-hexadec-7-enoyl-ACPs] == * common name: ** a (7Z)-3-oxo-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHINE XANTHINE] == * common name: ** xanthine * inchi key: ** InChIKey=LRFVTYWOQMYALW-UHFFFA...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHINE XANTHINE] == |
* common name: | * common name: | ||
− | ** | + | ** xanthine |
+ | * inchi key: | ||
+ | ** InChIKey=LRFVTYWOQMYALW-UHFFFAOYSA-N | ||
+ | * smiles: | ||
+ | ** C12(NC(=O)NC(C=1N=CN2)=O) | ||
+ | * molecular weight: | ||
+ | ** 152.112 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2,6-dioxopurine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[XANTHINE-OXIDASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN0-363]] |
+ | * [[RXN-7682]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN0-901]] | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: consumed by=RXN | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1188 1188] |
− | {{#set: produced by=RXN- | + | * METABOLIGHTS : MTBLC17712 |
+ | * HMDB : HMDB00292 | ||
+ | * DRUGBANK : DB02134 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00385 C00385] | ||
+ | * CAS : 69-89-6 | ||
+ | * BIGG : xan | ||
+ | * REFMET : Xanthine | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17712 17712] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.1151.html 1151] | ||
+ | {{#set: common name=xanthine}} | ||
+ | {{#set: inchi key=InChIKey=LRFVTYWOQMYALW-UHFFFAOYSA-N}} | ||
+ | {{#set: smiles=C12(NC(=O)NC(C=1N=CN2)=O)}} | ||
+ | {{#set: molecular weight=152.112 }} | ||
+ | {{#set: common name=2,6-dioxopurine}} | ||
+ | {{#set: consumed by=XANTHINE-OXIDASE-RXN}} | ||
+ | {{#set: produced by=RXN0-363|RXN-7682}} | ||
+ | {{#set: reversible reaction associated=RXN0-901}} |
Latest revision as of 14:18, 15 January 2021
Contents
Metabolite XANTHINE
- common name:
- xanthine
- inchi key:
- InChIKey=LRFVTYWOQMYALW-UHFFFAOYSA-N
- smiles:
- C12(NC(=O)NC(C=1N=CN2)=O)
- molecular weight:
- 152.112
- Synonym(s):
- 2,6-dioxopurine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- METABOLIGHTS : MTBLC17712
- HMDB : HMDB00292
- DRUGBANK : DB02134
- LIGAND-CPD:
- CAS : 69-89-6
- BIGG : xan
- REFMET : Xanthine
- CHEBI:
- CHEMSPIDER: