Difference between revisions of "L-1-LYSOPHOSPHATIDATE"
Jump to navigation
Jump to search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-HYDROXYBENZALDEHYDE 4-HYDROXYBENZALDEHYDE] == * common name: ** 4-hydroxybenzaldehyde * inchi...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-LYSOPHOSPHATIDATE L-1-LYSOPHOSPHATIDATE] == * common name: ** 1-oleyl-2-lyso-phosphatidate...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-LYSOPHOSPHATIDATE L-1-LYSOPHOSPHATIDATE] == |
* common name: | * common name: | ||
− | ** | + | ** 1-oleyl-2-lyso-phosphatidate |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=WRGQSWVCFNIUNZ-GDCKJWNLSA-L |
* smiles: | * smiles: | ||
− | ** [ | + | ** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 434.509 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** L-2-lysophosphatidate |
+ | ** lysophosphatidic acid | ||
+ | ** LPA | ||
+ | ** oleoyl lysophosphatidic acid | ||
+ | ** 1-oleoyl-lyso-phosphatidic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-15068]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173225 46173225] |
− | * | + | * METABOLIGHTS : MTBLC74544 |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74544 74544] |
− | + | {{#set: common name=1-oleyl-2-lyso-phosphatidate}} | |
− | + | {{#set: inchi key=InChIKey=WRGQSWVCFNIUNZ-GDCKJWNLSA-L}} | |
− | {{#set: common name= | + | {{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: molecular weight=434.509 }} |
− | {{#set: smiles=[ | + | {{#set: common name=L-2-lysophosphatidate|lysophosphatidic acid|LPA|oleoyl lysophosphatidic acid|1-oleoyl-lyso-phosphatidic acid}} |
− | {{#set: molecular weight= | + | {{#set: produced by=RXN-15068}} |
− | {{#set: common name= | ||
− | {{#set: |
Latest revision as of 14:18, 15 January 2021
Contents
Metabolite L-1-LYSOPHOSPHATIDATE
- common name:
- 1-oleyl-2-lyso-phosphatidate
- inchi key:
- InChIKey=WRGQSWVCFNIUNZ-GDCKJWNLSA-L
- smiles:
- CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O
- molecular weight:
- 434.509
- Synonym(s):
- L-2-lysophosphatidate
- lysophosphatidic acid
- LPA
- oleoyl lysophosphatidic acid
- 1-oleoyl-lyso-phosphatidic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
Property "Smiles" (as page type) with input value "CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.