Difference between revisions of "Ox-NADPH-Hemoprotein-Reductases"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACRYLYL-COA ACRYLYL-COA] == * common name: ** acryloyl-CoA * inchi key: ** InChIKey=POODSGUMUCV...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ox-NADPH-Hemoprotein-Reductases Ox-NADPH-Hemoprotein-Reductases] == * common name: ** an oxidiz...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACRYLYL-COA ACRYLYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ox-NADPH-Hemoprotein-Reductases Ox-NADPH-Hemoprotein-Reductases] ==
 
* common name:
 
* common name:
−
** acryloyl-CoA
+
** an oxidized [NADPH-hemoprotein reductase]
−
* inchi key:
 
−
** InChIKey=POODSGUMUCVRTR-IEXPHMLFSA-J
 
−
* smiles:
 
−
** C=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 
−
* molecular weight:
 
−
** 817.551   
 
 
* Synonym(s):
 
* Synonym(s):
−
** acrylyl-coenzyme A
 
−
** propenoyl-CoA
 
−
** acrylyl-CoA
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-15977]]
+
* [[UNSPECIFIC-MONOOXYGENASE-RXN]]
 +
* [[RXN66-599]]
 +
* [[RXN-8630]]
 +
* [[RXN-13064]]
 +
* [[RXN-8872]]
 +
* [[RXN66-589]]
 +
* [[SQUALENE-MONOOXYGENASE-RXN]]
 +
* [[RXN66-597]]
 +
* [[RXN-11056]]
 +
* [[RXN66-146]]
 +
* [[RXN66-161]]
 +
* [[RXN66-587]]
 +
* [[RXN66-594]]
 +
* [[RXN66-181]]
 +
* [[RXN66-598]]
 +
* [[RXN66-169]]
 +
* [[RXN66-163]]
 +
* [[RXN-17625]]
 +
* [[RXN66-596]]
 +
* [[RXN66-591]]
 +
* [[RXN66-595]]
 +
* [[RXN-11057]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-17627]]
 
== External links  ==
 
== External links  ==
−
* METABOLIGHTS : MTBLC57367
+
{{#set: common name=an oxidized [NADPH-hemoprotein reductase]}}
−
* LIGAND-CPD:
+
{{#set: produced by=UNSPECIFIC-MONOOXYGENASE-RXN|RXN66-599|RXN-8630|RXN-13064|RXN-8872|RXN66-589|SQUALENE-MONOOXYGENASE-RXN|RXN66-597|RXN-11056|RXN66-146|RXN66-161|RXN66-587|RXN66-594|RXN66-181|RXN66-598|RXN66-169|RXN66-163|RXN-17625|RXN66-596|RXN66-591|RXN66-595|RXN-11057}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00894 C00894]
+
{{#set: reversible reaction associated=RXN-17627}}
−
* CAS : 5776-58-9
 
−
* PUBCHEM:
 
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266595 45266595]
 
−
* HMDB : HMDB02307
 
−
* CHEBI:
 
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57367 57367]
 
−
{{#set: common name=acryloyl-CoA}}
 
−
{{#set: inchi key=InChIKey=POODSGUMUCVRTR-IEXPHMLFSA-J}}
 
−
{{#set: smiles=C=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
 
−
{{#set: molecular weight=817.551    }}
 
−
{{#set: common name=acrylyl-coenzyme A|propenoyl-CoA|acrylyl-CoA}}
 
−
{{#set: produced by=RXN-15977}}
 

Latest revision as of 14:18, 15 January 2021

Metabolite Ox-NADPH-Hemoprotein-Reductases

  • common name:
    • an oxidized [NADPH-hemoprotein reductase]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Property "Common name" (as page type) with input value "an oxidized [NADPH-hemoprotein reductase" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.


Retrieved from "http://gem-aureme.genouest.org//ucomgem/index.php?title=Ox-NADPH-Hemoprotein-Reductases&oldid=6875"