Difference between revisions of "CPD-12427"
Jump to navigation
Jump to search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADP-D-GLUCOSE ADP-D-GLUCOSE] == * common name: ** ADP-α-D-glucose * inchi key: ** InChIKe...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12427 CPD-12427] == * common name: ** 7,8-dihydro-8-oxoguanine * inchi key: ** InChIKey=CLG...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12427 CPD-12427] == |
* common name: | * common name: | ||
− | ** | + | ** 7,8-dihydro-8-oxoguanine |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=CLGFIVUFZRGQRP-UHFFFAOYSA-N |
* smiles: | * smiles: | ||
− | ** | + | ** C12(NC(=O)NC=1C(=O)NC(N)=N2) |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 167.127 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 8-oxoguanine |
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-18435]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C20155 C20155] | ||
+ | * HMDB : HMDB02032 | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.13984649.html 13984649] | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=65154 65154] |
− | + | * REFMET : 8-Hydroxyguanine | |
− | |||
− | |||
− | |||
− | * REFMET : | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=52617 52617] |
− | {{#set: common name= | + | {{#set: common name=7,8-dihydro-8-oxoguanine}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=CLGFIVUFZRGQRP-UHFFFAOYSA-N}} |
− | {{#set: smiles= | + | {{#set: smiles=C12(NC(=O)NC=1C(=O)NC(N)=N2)}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=167.127 }} |
− | {{#set: common name= | + | {{#set: common name=8-oxoguanine}} |
− | {{#set: produced by= | + | {{#set: produced by=RXN-18435}} |
− |
Latest revision as of 14:18, 15 January 2021
Contents
Metabolite CPD-12427
- common name:
- 7,8-dihydro-8-oxoguanine
- inchi key:
- InChIKey=CLGFIVUFZRGQRP-UHFFFAOYSA-N
- smiles:
- C12(NC(=O)NC=1C(=O)NC(N)=N2)
- molecular weight:
- 167.127
- Synonym(s):
- 8-oxoguanine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- LIGAND-CPD:
- HMDB : HMDB02032
- CHEMSPIDER:
- PUBCHEM:
- REFMET : 8-Hydroxyguanine
- CHEBI: