Difference between revisions of "Unsulfurated-Sulfur-Acceptors"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSYL-P4 ADENOSYL-P4] == * common name: ** 5',5'''-diadenosine tetraphosphate * inchi key: *...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Unsulfurated-Sulfur-Acceptors Unsulfurated-Sulfur-Acceptors] == * common name: ** an unsulfurat...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSYL-P4 ADENOSYL-P4] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Unsulfurated-Sulfur-Acceptors Unsulfurated-Sulfur-Acceptors] ==
 
* common name:
 
* common name:
−
** 5',5'''-diadenosine tetraphosphate
+
** an unsulfurated [sulfur carrier]
−
* inchi key:
 
−
** InChIKey=YOAHKNVSNCMZGQ-XPWFQUROSA-J
 
−
* smiles:
 
−
** C(C1(C(C(C(O1)N3(C=NC2(C(=NC=NC=23)N)))O)O))OP(OP(OP(OP(OCC4(C(C(C(O4)N6(C=NC5(C(=NC=NC=56)N)))O)O))([O-])=O)([O-])=O)([O-])=O)([O-])=O
 
−
* molecular weight:
 
−
** 832.36   
 
 
* Synonym(s):
 
* Synonym(s):
−
** Ap4A
+
** an unsulfurated [sulfur donor]
−
** AppppA
+
** an unsulfurated [sulfur acceptor]
−
** P(1),P(4)-bis(5'-adenosyl)tetraphosphate
 
−
** P1,P4-bis(5'-adenosyl)tetraphosphate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12588]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17472]]
 +
* [[RXN0-949]]
 +
* [[2.8.1.6-RXN]]
 +
* [[RXN-14959]]
 +
* [[RXN-14957]]
 +
* [[RXN-14950]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[ATP-ADENYLYLTRANSFERASE-RXN]]
+
* [[RXN-12587]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=an unsulfurated [sulfur carrier]}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243905 25243905]
+
{{#set: common name=an unsulfurated [sulfur donor]|an unsulfurated [sulfur acceptor]}}
−
* METABOLIGHTS : MTBLC58141
+
{{#set: consumed by=RXN-12588}}
−
* LIGAND-CPD:
+
{{#set: produced by=RXN-17472|RXN0-949|2.8.1.6-RXN|RXN-14959|RXN-14957|RXN-14950}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01260 C01260]
+
{{#set: reversible reaction associated=RXN-12587}}
−
* BIGG : ap4a
 
−
* HMDB : HMDB01211
 
−
* CHEBI:
 
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58141 58141]
 
−
{{#set: common name=5',5'''-diadenosine tetraphosphate}}
 
−
{{#set: inchi key=InChIKey=YOAHKNVSNCMZGQ-XPWFQUROSA-J}}
 
−
{{#set: smiles=C(C1(C(C(C(O1)N3(C=NC2(C(=NC=NC=23)N)))O)O))OP(OP(OP(OP(OCC4(C(C(C(O4)N6(C=NC5(C(=NC=NC=56)N)))O)O))([O-])=O)([O-])=O)([O-])=O)([O-])=O}}
 
−
{{#set: molecular weight=832.36    }}
 
−
{{#set: common name=Ap4A|AppppA|P(1),P(4)-bis(5'-adenosyl)tetraphosphate|P1,P4-bis(5'-adenosyl)tetraphosphate}}
 
−
{{#set: reversible reaction associated=ATP-ADENYLYLTRANSFERASE-RXN}}
 

Latest revision as of 14:18, 15 January 2021

Metabolite Unsulfurated-Sulfur-Acceptors

  • common name:
    • an unsulfurated [sulfur carrier]
  • Synonym(s):
    • an unsulfurated [sulfur donor]
    • an unsulfurated [sulfur acceptor]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Property "Common name" (as page type) with input value "an unsulfurated [sulfur carrier" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.

  • Property "Common name" (as page type) with input value "an unsulfurated [sulfur donor" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
  • Property "Common name" (as page type) with input value "an unsulfurated [sulfur acceptor" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.


Retrieved from "http://gem-aureme.genouest.org//ucomgem/index.php?title=Unsulfurated-Sulfur-Acceptors&oldid=7181"