Difference between revisions of "LINOLENOYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Hydroxy-Terminated-DNAs 3-Hydroxy-Terminated-DNAs] == * common name: ** a [DNA]-3'-hydroxyl *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINOLENOYL-COA LINOLENOYL-COA] == * common name: ** α-linolenoyl-CoA * inchi key: ** InCh...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINOLENOYL-COA LINOLENOYL-COA] == |
* common name: | * common name: | ||
− | ** | + | ** α-linolenoyl-CoA |
+ | * inchi key: | ||
+ | ** InChIKey=OMKFKBGZHNJNEX-KZWMEWPFSA-J | ||
+ | * smiles: | ||
+ | ** CCC=CCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)([O-])OP(=O)([O-])OCC3(OC(N2(C=NC1(C(N)=NC=NC=12)))C(O)C(OP(=O)([O-])[O-])3) | ||
+ | * molecular weight: | ||
+ | ** 1023.921 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 18:3Δ9,12,15 |
+ | ** (9Z,12Z,15Z)-octadecatrienoyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-13426]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859601 49859601] |
− | {{#set: consumed by=RXN- | + | * METABOLIGHTS : MTBLC51985 |
+ | * HMDB : HMDB06290 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C16162 C16162] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=51985 51985] | ||
+ | {{#set: common name=α-linolenoyl-CoA}} | ||
+ | {{#set: inchi key=InChIKey=OMKFKBGZHNJNEX-KZWMEWPFSA-J}} | ||
+ | {{#set: smiles=CCC=CCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)([O-])OP(=O)([O-])OCC3(OC(N2(C=NC1(C(N)=NC=NC=12)))C(O)C(OP(=O)([O-])[O-])3)}} | ||
+ | {{#set: molecular weight=1023.921 }} | ||
+ | {{#set: common name=18:3Δ9,12,15|(9Z,12Z,15Z)-octadecatrienoyl-CoA}} | ||
+ | {{#set: consumed by=RXN-13426}} |
Latest revision as of 14:18, 15 January 2021
Contents
Metabolite LINOLENOYL-COA
- common name:
- α-linolenoyl-CoA
- inchi key:
- InChIKey=OMKFKBGZHNJNEX-KZWMEWPFSA-J
- smiles:
- CCC=CCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)([O-])OP(=O)([O-])OCC3(OC(N2(C=NC1(C(N)=NC=NC=12)))C(O)C(OP(=O)([O-])[O-])3)
- molecular weight:
- 1023.921
- Synonym(s):
- 18:3Δ9,12,15
- (9Z,12Z,15Z)-octadecatrienoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
Property "Smiles" (as page type) with input value "CCC=CCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)([O-])OP(=O)([O-])OCC3(OC(N2(C=NC1(C(N)=NC=NC=12)))C(O)C(OP(=O)([O-])[O-])3)" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.