Difference between revisions of "Enoylglutaryl-ACP-methyl-esters"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-IMIDAZOLEACETATE 4-IMIDAZOLEACETATE] == * common name: ** 4-imidazoleacetate * inchi key: **...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Enoylglutaryl-ACP-methyl-esters Enoylglutaryl-ACP-methyl-esters] == * common name: ** an enoylg...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-IMIDAZOLEACETATE 4-IMIDAZOLEACETATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Enoylglutaryl-ACP-methyl-esters Enoylglutaryl-ACP-methyl-esters] ==
 
* common name:
 
* common name:
−
** 4-imidazoleacetate
+
** an enoylglutaryl-[acp] methyl ester
−
* inchi key:
 
−
** InChIKey=PRJKNHOMHKJCEJ-UHFFFAOYSA-M
 
−
* smiles:
 
−
** C1(NC=C(CC(=O)[O-])N=1)
 
−
* molecular weight:
 
−
** 125.107   
 
 
* Synonym(s):
 
* Synonym(s):
−
** imidazole-4-acetate
 
−
** imidazoleacetic acid
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-11478]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-10089]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* METABOLIGHTS : MTBLC57969
+
{{#set: common name=an enoylglutaryl-[acp] methyl ester}}
−
* LIGAND-CPD:
+
{{#set: consumed by=RXN-11478}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02835 C02835]
 
−
* GO-TERMS : (REFMET "Imidazoleacetic acid" NIL midford 3701443689 NIL NIL)
 
−
* CHEMSPIDER:
 
−
** [http://www.chemspider.com/Chemical-Structure.3351679.html 3351679]
 
−
* PUBCHEM:
 
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4139109 4139109]
 
−
* HMDB : HMDB02024
 
−
* CHEBI:
 
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57969 57969]
 
−
{{#set: common name=4-imidazoleacetate}}
 
−
{{#set: inchi key=InChIKey=PRJKNHOMHKJCEJ-UHFFFAOYSA-M}}
 
−
{{#set: smiles=C1(NC=C(CC(=O)[O-])N=1)}}
 
−
{{#set: molecular weight=125.107    }}
 
−
{{#set: common name=imidazole-4-acetate|imidazoleacetic acid}}
 
−
{{#set: produced by=RXN-10089}}
 

Latest revision as of 14:18, 15 January 2021

Metabolite Enoylglutaryl-ACP-methyl-esters

  • common name:
    • an enoylglutaryl-[acp] methyl ester
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Property "Common name" (as page type) with input value "an enoylglutaryl-[acp] methyl ester" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.

Retrieved from "http://gem-aureme.genouest.org//ucomgem/index.php?title=Enoylglutaryl-ACP-methyl-esters&oldid=7240"