Difference between revisions of "2-Hexadecenoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13357 CPD-13357] == * common name: ** (2R)-2,3-dihydroxy-3-methylbutanoate * inchi key: **...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Hexadecenoyl-ACPs 2-Hexadecenoyl-ACPs] == * common name: ** a trans hexadecenoyl-[acp] * Syno...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13357 CPD-13357] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Hexadecenoyl-ACPs 2-Hexadecenoyl-ACPs] ==
 
* common name:
 
* common name:
−
** (2R)-2,3-dihydroxy-3-methylbutanoate
+
** a trans hexadecenoyl-[acp]
−
* inchi key:
 
−
** InChIKey=JTEYKUFKXGDTEU-VKHMYHEASA-M
 
−
* smiles:
 
−
** CC(C)(O)C(O)C(=O)[O-]
 
−
* molecular weight:
 
−
** 133.124   
 
 
* Synonym(s):
 
* Synonym(s):
−
** (R)-2,3-dihydroxy-3-methylbutanoate
+
** a trans hexadec-2-enoyl-[acyl-carrier protein]
−
** (R)-2,3-dihydroxy-isovalerate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[DIHYDROXYISOVALDEHYDRAT-RXN]]
+
* [[RXN-9663]]
 +
* [[RXN-9542]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[ACETOLACTREDUCTOISOM-RXN]]
+
* [[4.2.1.61-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a trans hexadecenoyl-[acp]}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615351 23615351]
+
{{#set: common name=a trans hexadec-2-enoyl-[acyl-carrier protein]}}
−
* HMDB : HMDB12141
+
{{#set: consumed by=RXN-9663|RXN-9542}}
−
* LIGAND-CPD:
+
{{#set: produced by=4.2.1.61-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04272 C04272]
 
−
* CHEBI:
 
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49072 49072]
 
−
* CHEMSPIDER:
 
−
** [http://www.chemspider.com/Chemical-Structure.19951355.html 19951355]
 
−
{{#set: common name=(2R)-2,3-dihydroxy-3-methylbutanoate}}
 
−
{{#set: inchi key=InChIKey=JTEYKUFKXGDTEU-VKHMYHEASA-M}}
 
−
{{#set: smiles=CC(C)(O)C(O)C(=O)[O-]}}
 
−
{{#set: molecular weight=133.124    }}
 
−
{{#set: common name=(R)-2,3-dihydroxy-3-methylbutanoate|(R)-2,3-dihydroxy-isovalerate}}
 
−
{{#set: consumed by=DIHYDROXYISOVALDEHYDRAT-RXN}}
 
−
{{#set: produced by=ACETOLACTREDUCTOISOM-RXN}}
 

Latest revision as of 14:18, 15 January 2021

Metabolite 2-Hexadecenoyl-ACPs

  • common name:
    • a trans hexadecenoyl-[acp]
  • Synonym(s):
    • a trans hexadec-2-enoyl-[acyl-carrier protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Property "Common name" (as page type) with input value "a trans hexadecenoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process. Property "Common name" (as page type) with input value "a trans hexadec-2-enoyl-[acyl-carrier protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.


Retrieved from "http://gem-aureme.genouest.org//ucomgem/index.php?title=2-Hexadecenoyl-ACPs&oldid=7268"