Difference between revisions of "THR"
Jump to navigation
Jump to search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Hydroxyglutaryl-ACP-methyl-ester 3-Hydroxyglutaryl-ACP-methyl-ester] == * common name: ** a (...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THR THR] == * common name: ** L-threonine * inchi key: ** InChIKey=AYFVYJQAPQTCCC-GBXIJSLDSA-N...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THR THR] == |
* common name: | * common name: | ||
− | ** | + | ** L-threonine |
+ | * inchi key: | ||
+ | ** InChIKey=AYFVYJQAPQTCCC-GBXIJSLDSA-N | ||
+ | * smiles: | ||
+ | ** CC(O)C([N+])C(=O)[O-] | ||
+ | * molecular weight: | ||
+ | ** 119.12 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** T | ||
+ | ** thr | ||
+ | ** thre | ||
+ | ** L-thr | ||
+ | ** threonine | ||
+ | ** 2-amino-3-hydroxybutyric acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[THREONINE--TRNA-LIGASE-RXN]] | ||
+ | * [[THREDEHYD-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[THRESYN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-15122]] | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: produced by=RXN- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971019 6971019] |
+ | * METABOLIGHTS : MTBLC57926 | ||
+ | * HMDB : HMDB00167 | ||
+ | * CAS : 72-19-5 | ||
+ | * BIGG : thr__L | ||
+ | * REFMET : Threonine | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00188 C00188] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57926 57926] | ||
+ | {{#set: common name=L-threonine}} | ||
+ | {{#set: inchi key=InChIKey=AYFVYJQAPQTCCC-GBXIJSLDSA-N}} | ||
+ | {{#set: smiles=CC(O)C([N+])C(=O)[O-]}} | ||
+ | {{#set: molecular weight=119.12 }} | ||
+ | {{#set: common name=T|thr|thre|L-thr|threonine|2-amino-3-hydroxybutyric acid}} | ||
+ | {{#set: consumed by=THREONINE--TRNA-LIGASE-RXN|THREDEHYD-RXN}} | ||
+ | {{#set: produced by=THRESYN-RXN}} | ||
+ | {{#set: reversible reaction associated=RXN-15122}} |
Latest revision as of 14:19, 15 January 2021
Contents
Metabolite THR
- common name:
- L-threonine
- inchi key:
- InChIKey=AYFVYJQAPQTCCC-GBXIJSLDSA-N
- smiles:
- CC(O)C([N+])C(=O)[O-]
- molecular weight:
- 119.12
- Synonym(s):
- T
- thr
- thre
- L-thr
- threonine
- 2-amino-3-hydroxybutyric acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- METABOLIGHTS : MTBLC57926
- HMDB : HMDB00167
- CAS : 72-19-5
- BIGG : thr__L
- REFMET : Threonine
- LIGAND-CPD:
- CHEBI:
Property "Smiles" (as page type) with input value "CC(O)C([N+])C(=O)[O-" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.