Difference between revisions of "5-OXOPROLINE"
Jump to navigation
Jump to search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-Methylcytosine-DNA 5-Methylcytosine-DNA] == * common name: ** a 5-methylcytosine in DNA * Syn...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-OXOPROLINE 5-OXOPROLINE] == * common name: ** 5-oxo-L-proline * inchi key: ** InChIKey=ODHCTX...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-OXOPROLINE 5-OXOPROLINE] == |
* common name: | * common name: | ||
− | ** | + | ** 5-oxo-L-proline |
+ | * inchi key: | ||
+ | ** InChIKey=ODHCTXKNWHHXJC-VKHMYHEASA-M | ||
+ | * smiles: | ||
+ | ** C(=O)(C1(NC(CC1)=O))[O-] | ||
+ | * molecular weight: | ||
+ | ** 128.107 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** pyrrolidone-COO |
− | ** | + | ** pyrrolidone-carboxylate |
+ | ** L-5-pyrrolidone-2-carboxylic acid | ||
+ | ** L-pyroglutamic acid | ||
+ | ** pyroglutamic acid | ||
+ | ** pyroglutamate | ||
+ | ** 5-pyrrolidone-2-carboxylic acid | ||
+ | ** L-pyroglutamate | ||
+ | ** pidolic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[5-OXOPROLINASE-ATP-HYDROLYSING-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01879 C01879] |
− | {{#set: | + | * GO-TERMS : (REFMET "Pyroglutamic acid" NIL midford 3701443689 NIL NIL) |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4451146.html 4451146] | ||
+ | * CAS : 98-79-3 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5289118 5289118] | ||
+ | * HMDB : HMDB00267 | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58402 58402] | ||
+ | {{#set: common name=5-oxo-L-proline}} | ||
+ | {{#set: inchi key=InChIKey=ODHCTXKNWHHXJC-VKHMYHEASA-M}} | ||
+ | {{#set: smiles=C(=O)(C1(NC(CC1)=O))[O-]}} | ||
+ | {{#set: molecular weight=128.107 }} | ||
+ | {{#set: common name=pyrrolidone-COO|pyrrolidone-carboxylate|L-5-pyrrolidone-2-carboxylic acid|L-pyroglutamic acid|pyroglutamic acid|pyroglutamate|5-pyrrolidone-2-carboxylic acid|L-pyroglutamate|pidolic acid}} | ||
+ | {{#set: consumed by=5-OXOPROLINASE-ATP-HYDROLYSING-RXN}} |
Latest revision as of 14:19, 15 January 2021
Contents
Metabolite 5-OXOPROLINE
- common name:
- 5-oxo-L-proline
- inchi key:
- InChIKey=ODHCTXKNWHHXJC-VKHMYHEASA-M
- smiles:
- C(=O)(C1(NC(CC1)=O))[O-]
- molecular weight:
- 128.107
- Synonym(s):
- pyrrolidone-COO
- pyrrolidone-carboxylate
- L-5-pyrrolidone-2-carboxylic acid
- L-pyroglutamic acid
- pyroglutamic acid
- pyroglutamate
- 5-pyrrolidone-2-carboxylic acid
- L-pyroglutamate
- pidolic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- LIGAND-CPD:
- GO-TERMS : (REFMET "Pyroglutamic acid" NIL midford 3701443689 NIL NIL)
- CHEMSPIDER:
- CAS : 98-79-3
- PUBCHEM:
- HMDB : HMDB00267
- CHEBI:
Property "Smiles" (as page type) with input value "C(=O)(C1(NC(CC1)=O))[O-" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.